C28H36N2O — CID 71734668
(3S,8R,9S,10R,13S,14S)-17-(5,6-dimethylbenzimidazol-1-yl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 71734668) has the molecular formula C28H36N2O and a molecular weight of 416.61 g/mol. Its IUPAC name is (3S,8R,9S,10R,13S,14S)-17-(5,6-dimethylbenzimidazol-1-yl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (3S,8R,9S,10R,13S,14S)-17-(5,6-dimethylbenzimidazol-1-yl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 71734668 |
| Molecular Formula | C28H36N2O |
| Molecular Weight | 416.61 g/mol |
| Exact Mass | 416.28 |
| IUPAC Name | (3S,8R,9S,10R,13S,14S)-17-(5,6-dimethylbenzimidazol-1-yl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | Cc1cc2ncn(C3=CC[C@H]4[C@@H]5CC=C6C[C@@H](O)CC[C@]6(C)[C@H]5CC[C@]34C)c2cc1C |
| InChI | InChI=1S/C28H36N2O/c1-17-13-24-25(14-18(17)2)30(16-29-24)26-8-7-22-21-6-5-19-15-20(31)9-11-27(19,3)23(21)10-12-28(22,26)4/h5,8,13-14,16,20-23,31H,6-7,9-12,15H2,1-4H3/t20-,21-,22-,23-,27-,28-/m0/s1 |
| InChIKey | GXWBHVXZKPEFMM-APJCQQALSA-N |
| XLogP | 6.43 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.61 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|