C25H35NO6S2 — CID 71734684
3-[(3R,5R)-3-butyl-3-ethyl-7-methoxy-1,1-dioxo-5-phenyl-4,5-dihydro-2H-1λ6,4-benzothiazepin-8-yl]propane-1-sulfonic acid (PubChem CID 71734684) has the molecular formula C25H35NO6S2 and a molecular weight of 509.69 g/mol. Its IUPAC name is 3-[(3R,5R)-3-butyl-3-ethyl-7-methoxy-1,1-dioxo-5-phenyl-4,5-dihydro-2H-1λ6,4-benzothiazepin-8-yl]propane-1-sulfonic acid.
| Compound Name | 3-[(3R,5R)-3-butyl-3-ethyl-7-methoxy-1,1-dioxo-5-phenyl-4,5-dihydro-2H-1λ6,4-benzothiazepin-8-yl]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 71734684 |
| Molecular Formula | C25H35NO6S2 |
| Molecular Weight | 509.69 g/mol |
| Exact Mass | 509.19 |
| IUPAC Name | 3-[(3R,5R)-3-butyl-3-ethyl-7-methoxy-1,1-dioxo-5-phenyl-4,5-dihydro-2H-1λ6,4-benzothiazepin-8-yl]propane-1-sulfonic acid |
| SMILES | CCCC[C@]1(CC)CS(=O)(=O)c2cc(CCCS(=O)(=O)O)c(OC)cc2[C@@H](c2ccccc2)N1 |
| InChI | InChI=1S/C25H35NO6S2/c1-4-6-14-25(5-2)18-33(27,28)23-16-20(13-10-15-34(29,30)31)22(32-3)17-21(23)24(26-25)19-11-8-7-9-12-19/h7-9,11-12,16-17,24,26H,4-6,10,13-15,18H2,1-3H3,(H,29,30,31)/t24-,25-/m1/s1 |
| InChIKey | DQAQGHFLAWGFIR-JWQCQUIFSA-N |
| XLogP | 4.32 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.69 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|