C26H21BrF3N3O5 — CID 71734856
3-(1-benzofuran-3-yl)-4-[5-bromo-1-[3-(methylamino)propyl]indol-3-yl]pyrrole-2,5-dione;2,2,2-trifluoroacetic acid (PubChem CID 71734856) has the molecular formula C26H21BrF3N3O5 and a molecular weight of 592.37 g/mol. Its IUPAC name is 3-(1-benzofuran-3-yl)-4-[5-bromo-1-[3-(methylamino)propyl]indol-3-yl]pyrrole-2,5-dione;2,2,2-trifluoroacetic acid.
| Compound Name | 3-(1-benzofuran-3-yl)-4-[5-bromo-1-[3-(methylamino)propyl]indol-3-yl]pyrrole-2,5-dione;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 71734856 |
| Molecular Formula | C26H21BrF3N3O5 |
| Molecular Weight | 592.37 g/mol |
| Exact Mass | 591.06 |
| IUPAC Name | 3-(1-benzofuran-3-yl)-4-[5-bromo-1-[3-(methylamino)propyl]indol-3-yl]pyrrole-2,5-dione;2,2,2-trifluoroacetic acid |
| SMILES | CNCCCn1cc(C2=C(c3coc4ccccc34)C(=O)NC2=O)c2cc(Br)ccc21.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C24H20BrN3O3.C2HF3O2/c1-26-9-4-10-28-12-17(16-11-14(25)7-8-19(16)28)21-22(24(30)27-23(21)29)18-13-31-20-6-3-2-5-15(18)20;3-2(4,5)1(6)7/h2-3,5-8,11-13,26H,4,9-10H2,1H3,(H,27,29,30);(H,6,7) |
| InChIKey | FZTWOWOJDCIYJX-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 113.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.37 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|