C27H33N3O — CID 71734918
(E,8R,9S,10R,13S,14S)-17-(benzimidazol-1-yl)-N-methoxy-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthren-3-imine (PubChem CID 71734918) has the molecular formula C27H33N3O and a molecular weight of 415.58 g/mol. Its IUPAC name is (E,8R,9S,10R,13S,14S)-17-(benzimidazol-1-yl)-N-methoxy-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthren-3-imine.
| Compound Name | (E,8R,9S,10R,13S,14S)-17-(benzimidazol-1-yl)-N-methoxy-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthren-3-imine |
|---|---|
| PubChem CID | 71734918 |
| Molecular Formula | C27H33N3O |
| Molecular Weight | 415.58 g/mol |
| Exact Mass | 415.26 |
| IUPAC Name | (E,8R,9S,10R,13S,14S)-17-(benzimidazol-1-yl)-N-methoxy-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthren-3-imine |
| SMILES | CO/N=C1/C=C2CC[C@@H]3[C@H](CC[C@]4(C)C(n5cnc6ccccc65)=CC[C@@H]34)[C@@]2(C)CC1 |
| InChI | InChI=1S/C27H33N3O/c1-26-14-12-19(29-31-3)16-18(26)8-9-20-21-10-11-25(27(21,2)15-13-22(20)26)30-17-28-23-6-4-5-7-24(23)30/h4-7,11,16-17,20-22H,8-10,12-15H2,1-3H3/b29-19+/t20-,21-,22-,26-,27-/m0/s1 |
| InChIKey | XNIJZQMGGVARSK-JGFCEHDISA-N |
| XLogP | 6.45 |
| TPSA | 39.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.58 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|