C27H34N2O — CID 71734920
(8R,9S,10R,13S,14S)-17-(benzimidazol-1-yl)-3,10,13-trimethyl-1,2,6,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthren-3-ol (PubChem CID 71734920) has the molecular formula C27H34N2O and a molecular weight of 402.58 g/mol. Its IUPAC name is (8R,9S,10R,13S,14S)-17-(benzimidazol-1-yl)-3,10,13-trimethyl-1,2,6,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthren-3-ol.
| Compound Name | (8R,9S,10R,13S,14S)-17-(benzimidazol-1-yl)-3,10,13-trimethyl-1,2,6,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 71734920 |
| Molecular Formula | C27H34N2O |
| Molecular Weight | 402.58 g/mol |
| Exact Mass | 402.27 |
| IUPAC Name | (8R,9S,10R,13S,14S)-17-(benzimidazol-1-yl)-3,10,13-trimethyl-1,2,6,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthren-3-ol |
| SMILES | CC1(O)C=C2CC[C@@H]3[C@H](CC[C@]4(C)C(n5cnc6ccccc65)=CC[C@@H]34)[C@@]2(C)CC1 |
| InChI | InChI=1S/C27H34N2O/c1-25(30)14-15-26(2)18(16-25)8-9-19-20-10-11-24(27(20,3)13-12-21(19)26)29-17-28-22-6-4-5-7-23(22)29/h4-7,11,16-17,19-21,30H,8-10,12-15H2,1-3H3/t19-,20-,21-,25?,26-,27-/m0/s1 |
| InChIKey | BQNFIOYJQIGYGE-CQMXOSGXSA-N |
| XLogP | 6.20 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.58 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|