C36H40N2O4 — CID 71735008
2-[3-[2-[[(3S,8R,9S,10R,13S,14S)-17-(benzimidazol-1-yl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-2-oxoethyl]phenyl]acetic acid (PubChem CID 71735008) has the molecular formula C36H40N2O4 and a molecular weight of 564.73 g/mol. Its IUPAC name is 2-[3-[2-[[(3S,8R,9S,10R,13S,14S)-17-(benzimidazol-1-yl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-2-oxoethyl]phenyl]acetic acid.
| Compound Name | 2-[3-[2-[[(3S,8R,9S,10R,13S,14S)-17-(benzimidazol-1-yl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-2-oxoethyl]phenyl]acetic acid |
|---|---|
| PubChem CID | 71735008 |
| Molecular Formula | C36H40N2O4 |
| Molecular Weight | 564.73 g/mol |
| Exact Mass | 564.30 |
| IUPAC Name | 2-[3-[2-[[(3S,8R,9S,10R,13S,14S)-17-(benzimidazol-1-yl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-2-oxoethyl]phenyl]acetic acid |
| SMILES | C[C@]12CC[C@H](OC(=O)Cc3cccc(CC(=O)O)c3)CC1=CC[C@@H]1[C@@H]2CC[C@]2(C)C(n3cnc4ccccc43)=CC[C@@H]12 |
| InChI | InChI=1S/C36H40N2O4/c1-35-16-14-26(42-34(41)20-24-7-5-6-23(18-24)19-33(39)40)21-25(35)10-11-27-28-12-13-32(36(28,2)17-15-29(27)35)38-22-37-30-8-3-4-9-31(30)38/h3-10,13,18,22,26-29H,11-12,14-17,19-21H2,1-2H3,(H,39,40)/t26-,27-,28-,29-,35-,36-/m0/s1 |
| InChIKey | IUVDJJBDQBUQDG-QVNLIAGCSA-N |
| XLogP | 7.23 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.73 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|