C21H14N4O4 — CID 71735026
3-imidazo[1,2-a]pyridin-3-yl-4-(5-methyl-[1,3]dioxolo[4,5-f]indol-7-yl)pyrrole-2,5-dione (PubChem CID 71735026) has the molecular formula C21H14N4O4 and a molecular weight of 386.37 g/mol. Its IUPAC name is 3-imidazo[1,2-a]pyridin-3-yl-4-(5-methyl-[1,3]dioxolo[4,5-f]indol-7-yl)pyrrole-2,5-dione.
| Compound Name | 3-imidazo[1,2-a]pyridin-3-yl-4-(5-methyl-[1,3]dioxolo[4,5-f]indol-7-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 71735026 |
| Molecular Formula | C21H14N4O4 |
| Molecular Weight | 386.37 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | 3-imidazo[1,2-a]pyridin-3-yl-4-(5-methyl-[1,3]dioxolo[4,5-f]indol-7-yl)pyrrole-2,5-dione |
| SMILES | Cn1cc(C2=C(c3cnc4ccccn34)C(=O)NC2=O)c2cc3c(cc21)OCO3 |
| InChI | InChI=1S/C21H14N4O4/c1-24-9-12(11-6-15-16(7-13(11)24)29-10-28-15)18-19(21(27)23-20(18)26)14-8-22-17-4-2-3-5-25(14)17/h2-9H,10H2,1H3,(H,23,26,27) |
| InChIKey | XEBRJGQKFLSEOH-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 86.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.37 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|