About 4-imidazo[1,2-a]pyridin-6-yl-6-(trifluoromethyl)-1H-indazole
4-imidazo[1,2-a]pyridin-6-yl-6-(trifluoromethyl)-1H-indazole (PubChem CID 71735207) has the molecular formula C15H9F3N4
and a molecular weight of 302.26 g/mol. Its IUPAC name is 4-imidazo[1,2-a]pyridin-6-yl-6-(trifluoromethyl)-1H-indazole.
Molecular Properties
| Compound Name | 4-imidazo[1,2-a]pyridin-6-yl-6-(trifluoromethyl)-1H-indazole |
| PubChem CID | 71735207 |
| Molecular Formula | C15H9F3N4 |
| Molecular Weight | 302.26 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | 4-imidazo[1,2-a]pyridin-6-yl-6-(trifluoromethyl)-1H-indazole |
| SMILES | FC(F)(F)c1cc(-c2ccc3nccn3c2)c2cn[nH]c2c1 |
| InChI | InChI=1S/C15H9F3N4/c16-15(17,18)10-5-11(12-7-20-21-13(12)6-10)9-1-2-14-19-3-4-22(14)8-9/h1-8H,(H,20,21) |
| InChIKey | NIDNKFIXOVDXKL-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.26 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-imidazo[1,2-a]pyridin-6-yl-6-(trifluoromethyl)-1H-indazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-imidazo[1,2-a]pyridin-6-yl-6-(trifluoromethyl)-1H-indazole?
The IUPAC name of 4-imidazo[1,2-a]pyridin-6-yl-6-(trifluoromethyl)-1H-indazole (CID 71735207) is 4-imidazo[1,2-a]pyridin-6-yl-6-(trifluoromethyl)-1H-indazole.
What is the SMILES notation for 4-imidazo[1,2-a]pyridin-6-yl-6-(trifluoromethyl)-1H-indazole?
The canonical SMILES for 4-imidazo[1,2-a]pyridin-6-yl-6-(trifluoromethyl)-1H-indazole is FC(F)(F)c1cc(-c2ccc3nccn3c2)c2cn[nH]c2c1.
What is the InChIKey of 4-imidazo[1,2-a]pyridin-6-yl-6-(trifluoromethyl)-1H-indazole?
The InChIKey is NIDNKFIXOVDXKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H9F3N4/c16-15(17,18)10-5-11(12-7-20-21-13(12)6-10)9-1-2-14-19-3-4-22(14)8-9/h1-8H,(H,20,21).
What are the key properties of 4-imidazo[1,2-a]pyridin-6-yl-6-(trifluoromethyl)-1H-indazole?
4-imidazo[1,2-a]pyridin-6-yl-6-(trifluoromethyl)-1H-indazole has a molecular weight of 302.26 g/mol, XLogP of 3.90, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-imidazo[1,2-a]pyridin-6-yl-6-(trifluoromethyl)-1H-indazole is sourced from PubChem (CID 71735207), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).