About (2R)-2,3-dihydroxy-1-[6-[4-[4-(trifluoromethyl)phenoxy]phenyl]-2-pyridinyl]propan-1-one
(2R)-2,3-dihydroxy-1-[6-[4-[4-(trifluoromethyl)phenoxy]phenyl]-2-pyridinyl]propan-1-one (PubChem CID 71735260) has the molecular formula C21H16F3NO4
and a molecular weight of 403.36 g/mol. Its IUPAC name is (2R)-2,3-dihydroxy-1-[6-[4-[4-(trifluoromethyl)phenoxy]phenyl]-2-pyridinyl]propan-1-one.
Molecular Properties
| Compound Name | (2R)-2,3-dihydroxy-1-[6-[4-[4-(trifluoromethyl)phenoxy]phenyl]-2-pyridinyl]propan-1-one |
| PubChem CID | 71735260 |
| Molecular Formula | C21H16F3NO4 |
| Molecular Weight | 403.36 g/mol |
| Exact Mass | 403.10 |
| IUPAC Name | (2R)-2,3-dihydroxy-1-[6-[4-[4-(trifluoromethyl)phenoxy]phenyl]-2-pyridinyl]propan-1-one |
| SMILES | O=C(c1cccc(-c2ccc(Oc3ccc(C(F)(F)F)cc3)cc2)n1)[C@H](O)CO |
| InChI | InChI=1S/C21H16F3NO4/c22-21(23,24)14-6-10-16(11-7-14)29-15-8-4-13(5-9-15)17-2-1-3-18(25-17)20(28)19(27)12-26/h1-11,19,26-27H,12H2/t19-/m1/s1 |
| InChIKey | WBQTVHQWLVZLHR-LJQANCHMSA-N |
| XLogP | 4.10 |
| TPSA | 79.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 403.36 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2R)-2,3-dihydroxy-1-[6-[4-[4-(trifluoromethyl)phenoxy]phenyl]-2-pyridinyl]propan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2,3-dihydroxy-1-[6-[4-[4-(trifluoromethyl)phenoxy]phenyl]-2-pyridinyl]propan-1-one?
The IUPAC name of (2R)-2,3-dihydroxy-1-[6-[4-[4-(trifluoromethyl)phenoxy]phenyl]-2-pyridinyl]propan-1-one (CID 71735260) is (2R)-2,3-dihydroxy-1-[6-[4-[4-(trifluoromethyl)phenoxy]phenyl]-2-pyridinyl]propan-1-one.
What is the SMILES notation for (2R)-2,3-dihydroxy-1-[6-[4-[4-(trifluoromethyl)phenoxy]phenyl]-2-pyridinyl]propan-1-one?
The canonical SMILES for (2R)-2,3-dihydroxy-1-[6-[4-[4-(trifluoromethyl)phenoxy]phenyl]-2-pyridinyl]propan-1-one is O=C(c1cccc(-c2ccc(Oc3ccc(C(F)(F)F)cc3)cc2)n1)[C@H](O)CO.
What is the InChIKey of (2R)-2,3-dihydroxy-1-[6-[4-[4-(trifluoromethyl)phenoxy]phenyl]-2-pyridinyl]propan-1-one?
The InChIKey is WBQTVHQWLVZLHR-LJQANCHMSA-N. The full InChI is InChI=1S/C21H16F3NO4/c22-21(23,24)14-6-10-16(11-7-14)29-15-8-4-13(5-9-15)17-2-1-3-18(25-17)20(28)19(27)12-26/h1-11,19,26-27H,12H2/t19-/m1/s1.
What are the key properties of (2R)-2,3-dihydroxy-1-[6-[4-[4-(trifluoromethyl)phenoxy]phenyl]-2-pyridinyl]propan-1-one?
(2R)-2,3-dihydroxy-1-[6-[4-[4-(trifluoromethyl)phenoxy]phenyl]-2-pyridinyl]propan-1-one has a molecular weight of 403.36 g/mol, XLogP of 4.10, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2,3-dihydroxy-1-[6-[4-[4-(trifluoromethyl)phenoxy]phenyl]-2-pyridinyl]propan-1-one is sourced from PubChem (CID 71735260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).