C20H17FN6O — CID 71735477
2-[[6-(3-fluoro-4-methylphenyl)-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]methyl]-3,4-dihydro-2H-pyrido[3,2-b][1,4]oxazine (PubChem CID 71735477) has the molecular formula C20H17FN6O and a molecular weight of 376.40 g/mol. Its IUPAC name is 2-[[6-(3-fluoro-4-methylphenyl)-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]methyl]-3,4-dihydro-2H-pyrido[3,2-b][1,4]oxazine.
| Compound Name | 2-[[6-(3-fluoro-4-methylphenyl)-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]methyl]-3,4-dihydro-2H-pyrido[3,2-b][1,4]oxazine |
|---|---|
| PubChem CID | 71735477 |
| Molecular Formula | C20H17FN6O |
| Molecular Weight | 376.40 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | 2-[[6-(3-fluoro-4-methylphenyl)-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]methyl]-3,4-dihydro-2H-pyrido[3,2-b][1,4]oxazine |
| SMILES | Cc1ccc(-c2ccc3nnc(CC4CNc5ncccc5O4)n3n2)cc1F |
| InChI | InChI=1S/C20H17FN6O/c1-12-4-5-13(9-15(12)21)16-6-7-18-24-25-19(27(18)26-16)10-14-11-23-20-17(28-14)3-2-8-22-20/h2-9,14H,10-11H2,1H3,(H,22,23) |
| InChIKey | KSWDWNZFIIRVGH-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.40 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |