C24H40O2 — CID 71735599
(5E,9E,13E)-1-methoxy-6,10,14,18-tetramethylnonadeca-5,9,13,17-tetraen-2-one (PubChem CID 71735599) has the molecular formula C24H40O2 and a molecular weight of 360.58 g/mol. Its IUPAC name is (5E,9E,13E)-1-methoxy-6,10,14,18-tetramethylnonadeca-5,9,13,17-tetraen-2-one.
| Compound Name | (5E,9E,13E)-1-methoxy-6,10,14,18-tetramethylnonadeca-5,9,13,17-tetraen-2-one |
|---|---|
| PubChem CID | 71735599 |
| Molecular Formula | C24H40O2 |
| Molecular Weight | 360.58 g/mol |
| Exact Mass | 360.30 |
| IUPAC Name | (5E,9E,13E)-1-methoxy-6,10,14,18-tetramethylnonadeca-5,9,13,17-tetraen-2-one |
| SMILES | COCC(=O)CC/C=C(\C)CC/C=C(\C)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C24H40O2/c1-20(2)11-7-12-21(3)13-8-14-22(4)15-9-16-23(5)17-10-18-24(25)19-26-6/h11,13,15,17H,7-10,12,14,16,18-19H2,1-6H3/b21-13+,22-15+,23-17+ |
| InChIKey | FTLWQLTVDDXMIA-TUZVQDLTSA-N |
| XLogP | 7.13 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.58 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|