C20H22Cl2FN3O2 — CID 71735613
2,2-dichloro-N-[(1R,2S)-3-fluoro-1-hydroxy-1-[4-(6-pyrrolidin-2-yl-3-pyridinyl)phenyl]propan-2-yl]acetamide (PubChem CID 71735613) has the molecular formula C20H22Cl2FN3O2 and a molecular weight of 426.32 g/mol. Its IUPAC name is 2,2-dichloro-N-[(1R,2S)-3-fluoro-1-hydroxy-1-[4-(6-pyrrolidin-2-yl-3-pyridinyl)phenyl]propan-2-yl]acetamide.
| Compound Name | 2,2-dichloro-N-[(1R,2S)-3-fluoro-1-hydroxy-1-[4-(6-pyrrolidin-2-yl-3-pyridinyl)phenyl]propan-2-yl]acetamide |
|---|---|
| PubChem CID | 71735613 |
| Molecular Formula | C20H22Cl2FN3O2 |
| Molecular Weight | 426.32 g/mol |
| Exact Mass | 425.11 |
| IUPAC Name | 2,2-dichloro-N-[(1R,2S)-3-fluoro-1-hydroxy-1-[4-(6-pyrrolidin-2-yl-3-pyridinyl)phenyl]propan-2-yl]acetamide |
| SMILES | O=C(N[C@H](CF)[C@H](O)c1ccc(-c2ccc(C3CCCN3)nc2)cc1)C(Cl)Cl |
| InChI | InChI=1S/C20H22Cl2FN3O2/c21-19(22)20(28)26-17(10-23)18(27)13-5-3-12(4-6-13)14-7-8-16(25-11-14)15-2-1-9-24-15/h3-8,11,15,17-19,24,27H,1-2,9-10H2,(H,26,28)/t15?,17-,18-/m1/s1 |
| InChIKey | CJGDDRMHSGSVID-HSFDIDPMSA-N |
| XLogP | 3.46 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.32 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|