C23H24N10O — CID 71735711
5,6-bis(1-methylpyrazol-4-yl)-N-(4-morpholin-4-ylphenyl)-[1,2,4]triazolo[1,5-a]pyrazin-2-amine (PubChem CID 71735711) has the molecular formula C23H24N10O and a molecular weight of 456.51 g/mol. Its IUPAC name is 5,6-bis(1-methylpyrazol-4-yl)-N-(4-morpholin-4-ylphenyl)-[1,2,4]triazolo[1,5-a]pyrazin-2-amine.
| Compound Name | 5,6-bis(1-methylpyrazol-4-yl)-N-(4-morpholin-4-ylphenyl)-[1,2,4]triazolo[1,5-a]pyrazin-2-amine |
|---|---|
| PubChem CID | 71735711 |
| Molecular Formula | C23H24N10O |
| Molecular Weight | 456.51 g/mol |
| Exact Mass | 456.21 |
| IUPAC Name | 5,6-bis(1-methylpyrazol-4-yl)-N-(4-morpholin-4-ylphenyl)-[1,2,4]triazolo[1,5-a]pyrazin-2-amine |
| SMILES | Cn1cc(-c2ncc3nc(Nc4ccc(N5CCOCC5)cc4)nn3c2-c2cnn(C)c2)cn1 |
| InChI | InChI=1S/C23H24N10O/c1-30-14-16(11-25-30)21-22(17-12-26-31(2)15-17)33-20(13-24-21)28-23(29-33)27-18-3-5-19(6-4-18)32-7-9-34-10-8-32/h3-6,11-15H,7-10H2,1-2H3,(H,27,29) |
| InChIKey | MMBZMWDNDWMCRX-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 103.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.51 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|