About N-ethylethanamine;2-[4-[(2-oxocyclopentyl)methyl]phenyl]propanoic acid
N-ethylethanamine;2-[4-[(2-oxocyclopentyl)methyl]phenyl]propanoic acid (PubChem CID 71735846) has the molecular formula C19H29NO3
and a molecular weight of 319.45 g/mol. Its IUPAC name is N-ethylethanamine;2-[4-[(2-oxocyclopentyl)methyl]phenyl]propanoic acid.
Molecular Properties
| Compound Name | N-ethylethanamine;2-[4-[(2-oxocyclopentyl)methyl]phenyl]propanoic acid |
| PubChem CID | 71735846 |
| Molecular Formula | C19H29NO3 |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.21 |
| IUPAC Name | N-ethylethanamine;2-[4-[(2-oxocyclopentyl)methyl]phenyl]propanoic acid |
| SMILES | CC(C(=O)O)c1ccc(CC2CCCC2=O)cc1.CCNCC |
| InChI | InChI=1S/C15H18O3.C4H11N/c1-10(15(17)18)12-7-5-11(6-8-12)9-13-3-2-4-14(13)16;1-3-5-4-2/h5-8,10,13H,2-4,9H2,1H3,(H,17,18);5H,3-4H2,1-2H3 |
| InChIKey | GWLNGIQWMXQDKT-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-ethylethanamine;2-[4-[(2-oxocyclopentyl)methyl]phenyl]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethylethanamine;2-[4-[(2-oxocyclopentyl)methyl]phenyl]propanoic acid?
The IUPAC name of N-ethylethanamine;2-[4-[(2-oxocyclopentyl)methyl]phenyl]propanoic acid (CID 71735846) is N-ethylethanamine;2-[4-[(2-oxocyclopentyl)methyl]phenyl]propanoic acid.
What is the SMILES notation for N-ethylethanamine;2-[4-[(2-oxocyclopentyl)methyl]phenyl]propanoic acid?
The canonical SMILES for N-ethylethanamine;2-[4-[(2-oxocyclopentyl)methyl]phenyl]propanoic acid is CC(C(=O)O)c1ccc(CC2CCCC2=O)cc1.CCNCC.
What is the InChIKey of N-ethylethanamine;2-[4-[(2-oxocyclopentyl)methyl]phenyl]propanoic acid?
The InChIKey is GWLNGIQWMXQDKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18O3.C4H11N/c1-10(15(17)18)12-7-5-11(6-8-12)9-13-3-2-4-14(13)16;1-3-5-4-2/h5-8,10,13H,2-4,9H2,1H3,(H,17,18);5H,3-4H2,1-2H3.
What are the key properties of N-ethylethanamine;2-[4-[(2-oxocyclopentyl)methyl]phenyl]propanoic acid?
N-ethylethanamine;2-[4-[(2-oxocyclopentyl)methyl]phenyl]propanoic acid has a molecular weight of 319.45 g/mol, XLogP of 3.40, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethylethanamine;2-[4-[(2-oxocyclopentyl)methyl]phenyl]propanoic acid is sourced from PubChem (CID 71735846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).