C23H33BO5 — CID 71735979
[(2R,7R)-15,16-dimethoxy-2,6,6,10-tetramethyl-12-oxatetracyclo[9.7.0.02,7.013,18]octadeca-1(11),13,15,17-tetraen-14-yl]boronic acid (PubChem CID 71735979) has the molecular formula C23H33BO5 and a molecular weight of 400.32 g/mol. Its IUPAC name is [(2R,7R)-15,16-dimethoxy-2,6,6,10-tetramethyl-12-oxatetracyclo[9.7.0.02,7.013,18]octadeca-1(11),13,15,17-tetraen-14-yl]boronic acid.
| Compound Name | [(2R,7R)-15,16-dimethoxy-2,6,6,10-tetramethyl-12-oxatetracyclo[9.7.0.02,7.013,18]octadeca-1(11),13,15,17-tetraen-14-yl]boronic acid |
|---|---|
| PubChem CID | 71735979 |
| Molecular Formula | C23H33BO5 |
| Molecular Weight | 400.32 g/mol |
| Exact Mass | 400.24 |
| IUPAC Name | [(2R,7R)-15,16-dimethoxy-2,6,6,10-tetramethyl-12-oxatetracyclo[9.7.0.02,7.013,18]octadeca-1(11),13,15,17-tetraen-14-yl]boronic acid |
| SMILES | COc1cc2c3c(oc2c(B(O)O)c1OC)C(C)CC[C@@H]1C(C)(C)CCC[C@@]31C |
| InChI | InChI=1S/C23H33BO5/c1-13-8-9-16-22(2,3)10-7-11-23(16,4)17-14-12-15(27-5)21(28-6)18(24(25)26)20(14)29-19(13)17/h12-13,16,25-26H,7-11H2,1-6H3/t13?,16-,23-/m1/s1 |
| InChIKey | JMQAJBRYXAKJLZ-QSJXFOTGSA-N |
| XLogP | 4.11 |
| TPSA | 72.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.32 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|