C21H31BN2O11S2 — CID 71736145
[(2R,7R)-2,6,6,10-tetramethyl-15,16-bis(sulfooxyamino)-12-oxatetracyclo[9.7.0.02,7.013,18]octadeca-1(11),13,15,17-tetraen-14-yl]boronic acid (PubChem CID 71736145) has the molecular formula C21H31BN2O11S2 and a molecular weight of 562.43 g/mol. Its IUPAC name is [(2R,7R)-2,6,6,10-tetramethyl-15,16-bis(sulfooxyamino)-12-oxatetracyclo[9.7.0.02,7.013,18]octadeca-1(11),13,15,17-tetraen-14-yl]boronic acid.
| Compound Name | [(2R,7R)-2,6,6,10-tetramethyl-15,16-bis(sulfooxyamino)-12-oxatetracyclo[9.7.0.02,7.013,18]octadeca-1(11),13,15,17-tetraen-14-yl]boronic acid |
|---|---|
| PubChem CID | 71736145 |
| Molecular Formula | C21H31BN2O11S2 |
| Molecular Weight | 562.43 g/mol |
| Exact Mass | 562.15 |
| IUPAC Name | [(2R,7R)-2,6,6,10-tetramethyl-15,16-bis(sulfooxyamino)-12-oxatetracyclo[9.7.0.02,7.013,18]octadeca-1(11),13,15,17-tetraen-14-yl]boronic acid |
| SMILES | CC1CC[C@@H]2C(C)(C)CCC[C@@]2(C)c2c1oc1c(B(O)O)c(NOS(=O)(=O)O)c(NOS(=O)(=O)O)cc21 |
| InChI | InChI=1S/C21H31BN2O11S2/c1-11-6-7-14-20(2,3)8-5-9-21(14,4)15-12-10-13(23-34-36(27,28)29)17(24-35-37(30,31)32)16(22(25)26)19(12)33-18(11)15/h10-11,14,23-26H,5-9H2,1-4H3,(H,27,28,29)(H,30,31,32)/t11?,14-,21-/m1/s1 |
| InChIKey | KRVGLJBWQNQHEC-RFSUUAOQSA-N |
| XLogP | 2.39 |
| TPSA | 204.86 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.43 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|