About N'-(4-chloropyrimidin-2-yl)-N-(7-chloroquinolin-4-yl)propane-1,3-diamine
N'-(4-chloropyrimidin-2-yl)-N-(7-chloroquinolin-4-yl)propane-1,3-diamine (PubChem CID 71736285) has the molecular formula C16H15Cl2N5
and a molecular weight of 348.24 g/mol. Its IUPAC name is N'-(4-chloropyrimidin-2-yl)-N-(7-chloroquinolin-4-yl)propane-1,3-diamine.
Molecular Properties
| Compound Name | N'-(4-chloropyrimidin-2-yl)-N-(7-chloroquinolin-4-yl)propane-1,3-diamine |
| PubChem CID | 71736285 |
| Molecular Formula | C16H15Cl2N5 |
| Molecular Weight | 348.24 g/mol |
| Exact Mass | 347.07 |
| IUPAC Name | N'-(4-chloropyrimidin-2-yl)-N-(7-chloroquinolin-4-yl)propane-1,3-diamine |
| SMILES | Clc1ccc2c(NCCCNc3nccc(Cl)n3)ccnc2c1 |
| InChI | InChI=1S/C16H15Cl2N5/c17-11-2-3-12-13(4-8-20-14(12)10-11)19-6-1-7-21-16-22-9-5-15(18)23-16/h2-5,8-10H,1,6-7H2,(H,19,20)(H,21,22,23) |
| InChIKey | KNYVQHOAQKLRGM-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.24 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N'-(4-chloropyrimidin-2-yl)-N-(7-chloroquinolin-4-yl)propane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(4-chloropyrimidin-2-yl)-N-(7-chloroquinolin-4-yl)propane-1,3-diamine?
The IUPAC name of N'-(4-chloropyrimidin-2-yl)-N-(7-chloroquinolin-4-yl)propane-1,3-diamine (CID 71736285) is N'-(4-chloropyrimidin-2-yl)-N-(7-chloroquinolin-4-yl)propane-1,3-diamine.
What is the SMILES notation for N'-(4-chloropyrimidin-2-yl)-N-(7-chloroquinolin-4-yl)propane-1,3-diamine?
The canonical SMILES for N'-(4-chloropyrimidin-2-yl)-N-(7-chloroquinolin-4-yl)propane-1,3-diamine is Clc1ccc2c(NCCCNc3nccc(Cl)n3)ccnc2c1.
What is the InChIKey of N'-(4-chloropyrimidin-2-yl)-N-(7-chloroquinolin-4-yl)propane-1,3-diamine?
The InChIKey is KNYVQHOAQKLRGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15Cl2N5/c17-11-2-3-12-13(4-8-20-14(12)10-11)19-6-1-7-21-16-22-9-5-15(18)23-16/h2-5,8-10H,1,6-7H2,(H,19,20)(H,21,22,23).
What are the key properties of N'-(4-chloropyrimidin-2-yl)-N-(7-chloroquinolin-4-yl)propane-1,3-diamine?
N'-(4-chloropyrimidin-2-yl)-N-(7-chloroquinolin-4-yl)propane-1,3-diamine has a molecular weight of 348.24 g/mol, XLogP of 4.25, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(4-chloropyrimidin-2-yl)-N-(7-chloroquinolin-4-yl)propane-1,3-diamine is sourced from PubChem (CID 71736285), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).