C21H25ClN6 — CID 71736286
N-(7-chloroquinolin-4-yl)-N'-(2-piperidin-1-ylpyrimidin-4-yl)propane-1,3-diamine (PubChem CID 71736286) has the molecular formula C21H25ClN6 and a molecular weight of 396.93 g/mol. Its IUPAC name is N-(7-chloroquinolin-4-yl)-N'-(2-piperidin-1-ylpyrimidin-4-yl)propane-1,3-diamine.
| Compound Name | N-(7-chloroquinolin-4-yl)-N'-(2-piperidin-1-ylpyrimidin-4-yl)propane-1,3-diamine |
|---|---|
| PubChem CID | 71736286 |
| Molecular Formula | C21H25ClN6 |
| Molecular Weight | 396.93 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | N-(7-chloroquinolin-4-yl)-N'-(2-piperidin-1-ylpyrimidin-4-yl)propane-1,3-diamine |
| SMILES | Clc1ccc2c(NCCCNc3ccnc(N4CCCCC4)n3)ccnc2c1 |
| InChI | InChI=1S/C21H25ClN6/c22-16-5-6-17-18(7-11-24-19(17)15-16)23-9-4-10-25-20-8-12-26-21(27-20)28-13-2-1-3-14-28/h5-8,11-12,15H,1-4,9-10,13-14H2,(H,23,24)(H,25,26,27) |
| InChIKey | QBKYEWYSJJNGEU-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 65.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.93 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|