C21H27BCl2O3 — CID 71736310
[(2R,7R)-15,16-dichloro-2,6,6,10-tetramethyl-12-oxatetracyclo[9.7.0.02,7.013,18]octadeca-1(11),13,15,17-tetraen-14-yl]boronic acid (PubChem CID 71736310) has the molecular formula C21H27BCl2O3 and a molecular weight of 409.16 g/mol. Its IUPAC name is [(2R,7R)-15,16-dichloro-2,6,6,10-tetramethyl-12-oxatetracyclo[9.7.0.02,7.013,18]octadeca-1(11),13,15,17-tetraen-14-yl]boronic acid.
| Compound Name | [(2R,7R)-15,16-dichloro-2,6,6,10-tetramethyl-12-oxatetracyclo[9.7.0.02,7.013,18]octadeca-1(11),13,15,17-tetraen-14-yl]boronic acid |
|---|---|
| PubChem CID | 71736310 |
| Molecular Formula | C21H27BCl2O3 |
| Molecular Weight | 409.16 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | [(2R,7R)-15,16-dichloro-2,6,6,10-tetramethyl-12-oxatetracyclo[9.7.0.02,7.013,18]octadeca-1(11),13,15,17-tetraen-14-yl]boronic acid |
| SMILES | CC1CC[C@@H]2C(C)(C)CCC[C@@]2(C)c2c1oc1c(B(O)O)c(Cl)c(Cl)cc21 |
| InChI | InChI=1S/C21H27BCl2O3/c1-11-6-7-14-20(2,3)8-5-9-21(14,4)15-12-10-13(23)17(24)16(22(25)26)19(12)27-18(11)15/h10-11,14,25-26H,5-9H2,1-4H3/t11?,14-,21-/m1/s1 |
| InChIKey | UOGBBRDJCPXDIP-RFSUUAOQSA-N |
| XLogP | 5.40 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.16 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|