C25H29F2N5O4 — CID 71736424
5-[(2,6-difluoro-3,5-dimethoxyphenyl)methoxy]-N-[3-methoxy-4-(4-methylpiperazin-1-yl)phenyl]pyrimidin-2-amine (PubChem CID 71736424) has the molecular formula C25H29F2N5O4 and a molecular weight of 501.53 g/mol. Its IUPAC name is 5-[(2,6-difluoro-3,5-dimethoxyphenyl)methoxy]-N-[3-methoxy-4-(4-methylpiperazin-1-yl)phenyl]pyrimidin-2-amine.
| Compound Name | 5-[(2,6-difluoro-3,5-dimethoxyphenyl)methoxy]-N-[3-methoxy-4-(4-methylpiperazin-1-yl)phenyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 71736424 |
| Molecular Formula | C25H29F2N5O4 |
| Molecular Weight | 501.53 g/mol |
| Exact Mass | 501.22 |
| IUPAC Name | 5-[(2,6-difluoro-3,5-dimethoxyphenyl)methoxy]-N-[3-methoxy-4-(4-methylpiperazin-1-yl)phenyl]pyrimidin-2-amine |
| SMILES | COc1cc(Nc2ncc(OCc3c(F)c(OC)cc(OC)c3F)cn2)ccc1N1CCN(C)CC1 |
| InChI | InChI=1S/C25H29F2N5O4/c1-31-7-9-32(10-8-31)19-6-5-16(11-20(19)33-2)30-25-28-13-17(14-29-25)36-15-18-23(26)21(34-3)12-22(35-4)24(18)27/h5-6,11-14H,7-10,15H2,1-4H3,(H,28,29,30) |
| InChIKey | ZNKAWHBEDZZJIA-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 81.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.53 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|