C16H14ClF2N3O2 — CID 71736497
2-chloro-4-(8,8-difluoro-1-methyl-2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)-3-methylbenzonitrile (PubChem CID 71736497) has the molecular formula C16H14ClF2N3O2 and a molecular weight of 353.76 g/mol. Its IUPAC name is 2-chloro-4-(8,8-difluoro-1-methyl-2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)-3-methylbenzonitrile.
| Compound Name | 2-chloro-4-(8,8-difluoro-1-methyl-2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)-3-methylbenzonitrile |
|---|---|
| PubChem CID | 71736497 |
| Molecular Formula | C16H14ClF2N3O2 |
| Molecular Weight | 353.76 g/mol |
| Exact Mass | 353.07 |
| IUPAC Name | 2-chloro-4-(8,8-difluoro-1-methyl-2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)-3-methylbenzonitrile |
| SMILES | Cc1c(N2C(=O)N(C)C3(CCC(F)(F)C3)C2=O)ccc(C#N)c1Cl |
| InChI | InChI=1S/C16H14ClF2N3O2/c1-9-11(4-3-10(7-20)12(9)17)22-13(23)15(21(2)14(22)24)5-6-16(18,19)8-15/h3-4H,5-6,8H2,1-2H3 |
| InChIKey | HWVTWUDQPUNVEP-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 64.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.76 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|