C17H11F6N7 — CID 71736526
2-[5-fluoro-1-(3,3,4,4,4-pentafluorobutyl)pyrazolo[5,4-b]pyridin-3-yl]pyrido[2,3-d]pyrimidin-4-amine (PubChem CID 71736526) has the molecular formula C17H11F6N7 and a molecular weight of 427.31 g/mol. Its IUPAC name is 2-[5-fluoro-1-(3,3,4,4,4-pentafluorobutyl)pyrazolo[5,4-b]pyridin-3-yl]pyrido[2,3-d]pyrimidin-4-amine.
| Compound Name | 2-[5-fluoro-1-(3,3,4,4,4-pentafluorobutyl)pyrazolo[5,4-b]pyridin-3-yl]pyrido[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 71736526 |
| Molecular Formula | C17H11F6N7 |
| Molecular Weight | 427.31 g/mol |
| Exact Mass | 427.10 |
| IUPAC Name | 2-[5-fluoro-1-(3,3,4,4,4-pentafluorobutyl)pyrazolo[5,4-b]pyridin-3-yl]pyrido[2,3-d]pyrimidin-4-amine |
| SMILES | Nc1nc(-c2nn(CCC(F)(F)C(F)(F)F)c3ncc(F)cc23)nc2ncccc12 |
| InChI | InChI=1S/C17H11F6N7/c18-8-6-10-11(14-27-12(24)9-2-1-4-25-13(9)28-14)29-30(15(10)26-7-8)5-3-16(19,20)17(21,22)23/h1-2,4,6-7H,3,5H2,(H2,24,25,27,28) |
| InChIKey | SWAHPNQGAQAHGE-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 95.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.31 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|