About 2-chloro-4-[1-(2-fluoroethyl)-2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl]-3-methylbenzonitrile
2-chloro-4-[1-(2-fluoroethyl)-2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl]-3-methylbenzonitrile (PubChem CID 71736806) has the molecular formula C17H17ClFN3O2
and a molecular weight of 349.79 g/mol. Its IUPAC name is 2-chloro-4-[1-(2-fluoroethyl)-2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl]-3-methylbenzonitrile.
Molecular Properties
| Compound Name | 2-chloro-4-[1-(2-fluoroethyl)-2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl]-3-methylbenzonitrile |
| PubChem CID | 71736806 |
| Molecular Formula | C17H17ClFN3O2 |
| Molecular Weight | 349.79 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | 2-chloro-4-[1-(2-fluoroethyl)-2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl]-3-methylbenzonitrile |
| SMILES | Cc1c(N2C(=O)N(CCF)C3(CCCC3)C2=O)ccc(C#N)c1Cl |
| InChI | InChI=1S/C17H17ClFN3O2/c1-11-13(5-4-12(10-20)14(11)18)22-15(23)17(6-2-3-7-17)21(9-8-19)16(22)24/h4-5H,2-3,6-9H2,1H3 |
| InChIKey | HDFRHJZSRDTGQN-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 64.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.79 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-4-[1-(2-fluoroethyl)-2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl]-3-methylbenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-4-[1-(2-fluoroethyl)-2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl]-3-methylbenzonitrile?
The IUPAC name of 2-chloro-4-[1-(2-fluoroethyl)-2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl]-3-methylbenzonitrile (CID 71736806) is 2-chloro-4-[1-(2-fluoroethyl)-2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl]-3-methylbenzonitrile.
What is the SMILES notation for 2-chloro-4-[1-(2-fluoroethyl)-2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl]-3-methylbenzonitrile?
The canonical SMILES for 2-chloro-4-[1-(2-fluoroethyl)-2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl]-3-methylbenzonitrile is Cc1c(N2C(=O)N(CCF)C3(CCCC3)C2=O)ccc(C#N)c1Cl.
What is the InChIKey of 2-chloro-4-[1-(2-fluoroethyl)-2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl]-3-methylbenzonitrile?
The InChIKey is HDFRHJZSRDTGQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17ClFN3O2/c1-11-13(5-4-12(10-20)14(11)18)22-15(23)17(6-2-3-7-17)21(9-8-19)16(22)24/h4-5H,2-3,6-9H2,1H3.
What are the key properties of 2-chloro-4-[1-(2-fluoroethyl)-2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl]-3-methylbenzonitrile?
2-chloro-4-[1-(2-fluoroethyl)-2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl]-3-methylbenzonitrile has a molecular weight of 349.79 g/mol, XLogP of 3.57, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-4-[1-(2-fluoroethyl)-2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl]-3-methylbenzonitrile is sourced from PubChem (CID 71736806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).