About 4-(3,6-dimethoxypyridazin-4-yl)-6-(trifluoromethyl)-1H-indazole
4-(3,6-dimethoxypyridazin-4-yl)-6-(trifluoromethyl)-1H-indazole (PubChem CID 71736823) has the molecular formula C14H11F3N4O2
and a molecular weight of 324.26 g/mol. Its IUPAC name is 4-(3,6-dimethoxypyridazin-4-yl)-6-(trifluoromethyl)-1H-indazole.
Molecular Properties
| Compound Name | 4-(3,6-dimethoxypyridazin-4-yl)-6-(trifluoromethyl)-1H-indazole |
| PubChem CID | 71736823 |
| Molecular Formula | C14H11F3N4O2 |
| Molecular Weight | 324.26 g/mol |
| Exact Mass | 324.08 |
| IUPAC Name | 4-(3,6-dimethoxypyridazin-4-yl)-6-(trifluoromethyl)-1H-indazole |
| SMILES | COc1cc(-c2cc(C(F)(F)F)cc3[nH]ncc23)c(OC)nn1 |
| InChI | InChI=1S/C14H11F3N4O2/c1-22-12-5-9(13(23-2)21-20-12)8-3-7(14(15,16)17)4-11-10(8)6-18-19-11/h3-6H,1-2H3,(H,18,19) |
| InChIKey | CGTLYVBBVJTXTR-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 72.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.26 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(3,6-dimethoxypyridazin-4-yl)-6-(trifluoromethyl)-1H-indazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3,6-dimethoxypyridazin-4-yl)-6-(trifluoromethyl)-1H-indazole?
The IUPAC name of 4-(3,6-dimethoxypyridazin-4-yl)-6-(trifluoromethyl)-1H-indazole (CID 71736823) is 4-(3,6-dimethoxypyridazin-4-yl)-6-(trifluoromethyl)-1H-indazole.
What is the SMILES notation for 4-(3,6-dimethoxypyridazin-4-yl)-6-(trifluoromethyl)-1H-indazole?
The canonical SMILES for 4-(3,6-dimethoxypyridazin-4-yl)-6-(trifluoromethyl)-1H-indazole is COc1cc(-c2cc(C(F)(F)F)cc3[nH]ncc23)c(OC)nn1.
What is the InChIKey of 4-(3,6-dimethoxypyridazin-4-yl)-6-(trifluoromethyl)-1H-indazole?
The InChIKey is CGTLYVBBVJTXTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11F3N4O2/c1-22-12-5-9(13(23-2)21-20-12)8-3-7(14(15,16)17)4-11-10(8)6-18-19-11/h3-6H,1-2H3,(H,18,19).
What are the key properties of 4-(3,6-dimethoxypyridazin-4-yl)-6-(trifluoromethyl)-1H-indazole?
4-(3,6-dimethoxypyridazin-4-yl)-6-(trifluoromethyl)-1H-indazole has a molecular weight of 324.26 g/mol, XLogP of 3.06, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,6-dimethoxypyridazin-4-yl)-6-(trifluoromethyl)-1H-indazole is sourced from PubChem (CID 71736823), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).