About 3-methoxy-4-(1,3-oxazol-5-yl)-N-(thiophen-2-ylmethyl)aniline
3-methoxy-4-(1,3-oxazol-5-yl)-N-(thiophen-2-ylmethyl)aniline (PubChem CID 71736826) has the molecular formula C15H14N2O2S
and a molecular weight of 286.36 g/mol. Its IUPAC name is 3-methoxy-4-(1,3-oxazol-5-yl)-N-(thiophen-2-ylmethyl)aniline.
Molecular Properties
| Compound Name | 3-methoxy-4-(1,3-oxazol-5-yl)-N-(thiophen-2-ylmethyl)aniline |
| PubChem CID | 71736826 |
| Molecular Formula | C15H14N2O2S |
| Molecular Weight | 286.36 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | 3-methoxy-4-(1,3-oxazol-5-yl)-N-(thiophen-2-ylmethyl)aniline |
| SMILES | COc1cc(NCc2cccs2)ccc1-c1cnco1 |
| InChI | InChI=1S/C15H14N2O2S/c1-18-14-7-11(17-8-12-3-2-6-20-12)4-5-13(14)15-9-16-10-19-15/h2-7,9-10,17H,8H2,1H3 |
| InChIKey | AWUIYFVARPNPQU-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 47.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.36 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-methoxy-4-(1,3-oxazol-5-yl)-N-(thiophen-2-ylmethyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxy-4-(1,3-oxazol-5-yl)-N-(thiophen-2-ylmethyl)aniline?
The IUPAC name of 3-methoxy-4-(1,3-oxazol-5-yl)-N-(thiophen-2-ylmethyl)aniline (CID 71736826) is 3-methoxy-4-(1,3-oxazol-5-yl)-N-(thiophen-2-ylmethyl)aniline.
What is the SMILES notation for 3-methoxy-4-(1,3-oxazol-5-yl)-N-(thiophen-2-ylmethyl)aniline?
The canonical SMILES for 3-methoxy-4-(1,3-oxazol-5-yl)-N-(thiophen-2-ylmethyl)aniline is COc1cc(NCc2cccs2)ccc1-c1cnco1.
What is the InChIKey of 3-methoxy-4-(1,3-oxazol-5-yl)-N-(thiophen-2-ylmethyl)aniline?
The InChIKey is AWUIYFVARPNPQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14N2O2S/c1-18-14-7-11(17-8-12-3-2-6-20-12)4-5-13(14)15-9-16-10-19-15/h2-7,9-10,17H,8H2,1H3.
What are the key properties of 3-methoxy-4-(1,3-oxazol-5-yl)-N-(thiophen-2-ylmethyl)aniline?
3-methoxy-4-(1,3-oxazol-5-yl)-N-(thiophen-2-ylmethyl)aniline has a molecular weight of 286.36 g/mol, XLogP of 4.02, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxy-4-(1,3-oxazol-5-yl)-N-(thiophen-2-ylmethyl)aniline is sourced from PubChem (CID 71736826), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).