C16H26N6O6 — CID 71737383
(2S)-6-amino-2-[[(2S)-2-[[(2S)-2-amino-3-carboxypropanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]hexanoic acid (PubChem CID 71737383) has the molecular formula C16H26N6O6 and a molecular weight of 398.42 g/mol. Its IUPAC name is (2S)-6-amino-2-[[(2S)-2-[[(2S)-2-amino-3-carboxypropanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]hexanoic acid.
| Compound Name | (2S)-6-amino-2-[[(2S)-2-[[(2S)-2-amino-3-carboxypropanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 71737383 |
| Molecular Formula | C16H26N6O6 |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.19 |
| IUPAC Name | (2S)-6-amino-2-[[(2S)-2-[[(2S)-2-amino-3-carboxypropanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]hexanoic acid |
| SMILES | NCCCC[C@H](NC(=O)[C@H](Cc1cnc[nH]1)NC(=O)[C@@H](N)CC(=O)O)C(=O)O |
| InChI | InChI=1S/C16H26N6O6/c17-4-2-1-3-11(16(27)28)21-15(26)12(5-9-7-19-8-20-9)22-14(25)10(18)6-13(23)24/h7-8,10-12H,1-6,17-18H2,(H,19,20)(H,21,26)(H,22,25)(H,23,24)(H,27,28)/t10-,11-,12-/m0/s1 |
| InChIKey | ODNWIBOCFGMRTP-SRVKXCTJSA-N |
| XLogP | -2.06 |
| TPSA | 213.52 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | -2.06 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|