C16H18Cl2FN3O2S — CID 71737513
N-[(1R,2S)-1-[4-[2-(1-aminoethyl)-1,3-thiazol-5-yl]phenyl]-3-fluoro-1-hydroxypropan-2-yl]-2,2-dichloroacetamide (PubChem CID 71737513) has the molecular formula C16H18Cl2FN3O2S and a molecular weight of 406.31 g/mol. Its IUPAC name is N-[(1R,2S)-1-[4-[2-(1-aminoethyl)-1,3-thiazol-5-yl]phenyl]-3-fluoro-1-hydroxypropan-2-yl]-2,2-dichloroacetamide.
| Compound Name | N-[(1R,2S)-1-[4-[2-(1-aminoethyl)-1,3-thiazol-5-yl]phenyl]-3-fluoro-1-hydroxypropan-2-yl]-2,2-dichloroacetamide |
|---|---|
| PubChem CID | 71737513 |
| Molecular Formula | C16H18Cl2FN3O2S |
| Molecular Weight | 406.31 g/mol |
| Exact Mass | 405.05 |
| IUPAC Name | N-[(1R,2S)-1-[4-[2-(1-aminoethyl)-1,3-thiazol-5-yl]phenyl]-3-fluoro-1-hydroxypropan-2-yl]-2,2-dichloroacetamide |
| SMILES | CC(N)c1ncc(-c2ccc([C@@H](O)[C@@H](CF)NC(=O)C(Cl)Cl)cc2)s1 |
| InChI | InChI=1S/C16H18Cl2FN3O2S/c1-8(20)16-21-7-12(25-16)9-2-4-10(5-3-9)13(23)11(6-19)22-15(24)14(17)18/h2-5,7-8,11,13-14,23H,6,20H2,1H3,(H,22,24)/t8?,11-,13-/m1/s1 |
| InChIKey | VTLQQLOYRCBDHM-AGBJPPAESA-N |
| XLogP | 3.12 |
| TPSA | 88.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.31 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|