C12H17N4O7+ — CID 71737843
6-(hydroxymethyl)-8-[(2R,3S,4R)-2,3,4,5-tetrahydroxypentyl]-1H-pteridin-8-ium-2,4-dione (PubChem CID 71737843) has the molecular formula C12H17N4O7+ and a molecular weight of 329.29 g/mol. Its IUPAC name is 6-(hydroxymethyl)-8-[(2R,3S,4R)-2,3,4,5-tetrahydroxypentyl]-1H-pteridin-8-ium-2,4-dione.
| Compound Name | 6-(hydroxymethyl)-8-[(2R,3S,4R)-2,3,4,5-tetrahydroxypentyl]-1H-pteridin-8-ium-2,4-dione |
|---|---|
| PubChem CID | 71737843 |
| Molecular Formula | C12H17N4O7+ |
| Molecular Weight | 329.29 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | 6-(hydroxymethyl)-8-[(2R,3S,4R)-2,3,4,5-tetrahydroxypentyl]-1H-pteridin-8-ium-2,4-dione |
| SMILES | O=c1[nH]c(=O)c2nc(CO)c[n+](C[C@@H](O)[C@H](O)[C@H](O)CO)c2[nH]1 |
| InChI | InChI=1S/C12H16N4O7/c17-3-5-1-16(2-6(19)9(21)7(20)4-18)10-8(13-5)11(22)15-12(23)14-10/h1,6-7,9,17-21H,2-4H2,(H,15,22,23)/p+1/t6-,7-,9+/m1/s1 |
| InChIKey | RTNMDIMJQSRAGT-BHNWBGBOSA-O |
| XLogP | -4.53 |
| TPSA | 183.64 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.29 |
| LogP ≤ 5 | -4.53 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|