About (5R)-5-(4-chlorophenyl)imidazo[1,2-b]isoindol-5-ol
(5R)-5-(4-chlorophenyl)imidazo[1,2-b]isoindol-5-ol (PubChem CID 71737853) has the molecular formula C16H11ClN2O
and a molecular weight of 282.73 g/mol. Its IUPAC name is (5R)-5-(4-chlorophenyl)imidazo[1,2-b]isoindol-5-ol.
Molecular Properties
| Compound Name | (5R)-5-(4-chlorophenyl)imidazo[1,2-b]isoindol-5-ol |
| PubChem CID | 71737853 |
| Molecular Formula | C16H11ClN2O |
| Molecular Weight | 282.73 g/mol |
| Exact Mass | 282.06 |
| IUPAC Name | (5R)-5-(4-chlorophenyl)imidazo[1,2-b]isoindol-5-ol |
| SMILES | O[C@]1(c2ccc(Cl)cc2)c2ccccc2-c2nccn21 |
| InChI | InChI=1S/C16H11ClN2O/c17-12-7-5-11(6-8-12)16(20)14-4-2-1-3-13(14)15-18-9-10-19(15)16/h1-10,20H/t16-/m1/s1 |
| InChIKey | RXDGKDABIKRSEL-MRXNPFEDSA-N |
| XLogP | 3.26 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.73 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (5R)-5-(4-chlorophenyl)imidazo[1,2-b]isoindol-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R)-5-(4-chlorophenyl)imidazo[1,2-b]isoindol-5-ol?
The IUPAC name of (5R)-5-(4-chlorophenyl)imidazo[1,2-b]isoindol-5-ol (CID 71737853) is (5R)-5-(4-chlorophenyl)imidazo[1,2-b]isoindol-5-ol.
What is the SMILES notation for (5R)-5-(4-chlorophenyl)imidazo[1,2-b]isoindol-5-ol?
The canonical SMILES for (5R)-5-(4-chlorophenyl)imidazo[1,2-b]isoindol-5-ol is O[C@]1(c2ccc(Cl)cc2)c2ccccc2-c2nccn21.
What is the InChIKey of (5R)-5-(4-chlorophenyl)imidazo[1,2-b]isoindol-5-ol?
The InChIKey is RXDGKDABIKRSEL-MRXNPFEDSA-N. The full InChI is InChI=1S/C16H11ClN2O/c17-12-7-5-11(6-8-12)16(20)14-4-2-1-3-13(14)15-18-9-10-19(15)16/h1-10,20H/t16-/m1/s1.
What are the key properties of (5R)-5-(4-chlorophenyl)imidazo[1,2-b]isoindol-5-ol?
(5R)-5-(4-chlorophenyl)imidazo[1,2-b]isoindol-5-ol has a molecular weight of 282.73 g/mol, XLogP of 3.26, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5R)-5-(4-chlorophenyl)imidazo[1,2-b]isoindol-5-ol is sourced from PubChem (CID 71737853), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).