C12H13IN2 — CID 71738002
6-iodo-2,3,4,9-tetrahydro-1H-carbazol-1-amine (PubChem CID 71738002) has the molecular formula C12H13IN2 and a molecular weight of 312.15 g/mol. Its IUPAC name is 6-iodo-2,3,4,9-tetrahydro-1H-carbazol-1-amine.
| Compound Name | 6-iodo-2,3,4,9-tetrahydro-1H-carbazol-1-amine |
|---|---|
| PubChem CID | 71738002 |
| Molecular Formula | C12H13IN2 |
| Molecular Weight | 312.15 g/mol |
| Exact Mass | 312.01 |
| IUPAC Name | 6-iodo-2,3,4,9-tetrahydro-1H-carbazol-1-amine |
| SMILES | NC1CCCc2c1[nH]c1ccc(I)cc21 |
| InChI | InChI=1S/C12H13IN2/c13-7-4-5-11-9(6-7)8-2-1-3-10(14)12(8)15-11/h4-6,10,15H,1-3,14H2 |
| InChIKey | NAOUQJDQTBBRNY-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 41.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.15 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|