C16H20BrF4N3O2 — CID 71739004
methyl 2-[5-bromo-2-[[di(propan-2-yl)amino]diazenyl]phenyl]-2,3,3,3-tetrafluoropropanoate (PubChem CID 71739004) has the molecular formula C16H20BrF4N3O2 and a molecular weight of 442.25 g/mol. Its IUPAC name is methyl 2-[5-bromo-2-[[di(propan-2-yl)amino]diazenyl]phenyl]-2,3,3,3-tetrafluoropropanoate.
| Compound Name | methyl 2-[5-bromo-2-[[di(propan-2-yl)amino]diazenyl]phenyl]-2,3,3,3-tetrafluoropropanoate |
|---|---|
| PubChem CID | 71739004 |
| Molecular Formula | C16H20BrF4N3O2 |
| Molecular Weight | 442.25 g/mol |
| Exact Mass | 441.07 |
| IUPAC Name | methyl 2-[5-bromo-2-[[di(propan-2-yl)amino]diazenyl]phenyl]-2,3,3,3-tetrafluoropropanoate |
| SMILES | COC(=O)C(F)(c1cc(Br)ccc1/N=N/N(C(C)C)C(C)C)C(F)(F)F |
| InChI | InChI=1S/C16H20BrF4N3O2/c1-9(2)24(10(3)4)23-22-13-7-6-11(17)8-12(13)15(18,14(25)26-5)16(19,20)21/h6-10H,1-5H3/b23-22+ |
| InChIKey | HPQDCDGXJZMFPN-GHVJWSGMSA-N |
| XLogP | 5.47 |
| TPSA | 54.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.25 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|