About 3H-[1]benzothiolo[3,2-e]benzimidazole
3H-[1]benzothiolo[3,2-e]benzimidazole (PubChem CID 71739036) has the molecular formula C13H8N2S
and a molecular weight of 224.29 g/mol. Its IUPAC name is 3H-[1]benzothiolo[3,2-e]benzimidazole.
Molecular Properties
| Compound Name | 3H-[1]benzothiolo[3,2-e]benzimidazole |
| PubChem CID | 71739036 |
| Molecular Formula | C13H8N2S |
| Molecular Weight | 224.29 g/mol |
| Exact Mass | 224.04 |
| IUPAC Name | 3H-[1]benzothiolo[3,2-e]benzimidazole |
| SMILES | c1ccc2c(c1)sc1ccc3[nH]cnc3c12 |
| InChI | InChI=1S/C13H8N2S/c1-2-4-10-8(3-1)12-11(16-10)6-5-9-13(12)15-7-14-9/h1-7H,(H,14,15) |
| InChIKey | RXIBIMOALHAANA-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.29 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3H-[1]benzothiolo[3,2-e]benzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3H-[1]benzothiolo[3,2-e]benzimidazole?
The IUPAC name of 3H-[1]benzothiolo[3,2-e]benzimidazole (CID 71739036) is 3H-[1]benzothiolo[3,2-e]benzimidazole.
What is the SMILES notation for 3H-[1]benzothiolo[3,2-e]benzimidazole?
The canonical SMILES for 3H-[1]benzothiolo[3,2-e]benzimidazole is c1ccc2c(c1)sc1ccc3[nH]cnc3c12.
What is the InChIKey of 3H-[1]benzothiolo[3,2-e]benzimidazole?
The InChIKey is RXIBIMOALHAANA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8N2S/c1-2-4-10-8(3-1)12-11(16-10)6-5-9-13(12)15-7-14-9/h1-7H,(H,14,15).
What are the key properties of 3H-[1]benzothiolo[3,2-e]benzimidazole?
3H-[1]benzothiolo[3,2-e]benzimidazole has a molecular weight of 224.29 g/mol, XLogP of 3.93, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3H-[1]benzothiolo[3,2-e]benzimidazole is sourced from PubChem (CID 71739036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).