C25H42O5Si — CID 71739161
(4S,5R)-5-(8-methyl-1,4-dioxaspiro[4.4]non-8-en-9-yl)-4-[(1S)-1-tri(propan-2-yl)silyloxybut-3-enyl]oxolan-2-one (PubChem CID 71739161) has the molecular formula C25H42O5Si and a molecular weight of 450.69 g/mol. Its IUPAC name is (4S,5R)-5-(8-methyl-1,4-dioxaspiro[4.4]non-8-en-9-yl)-4-[(1S)-1-tri(propan-2-yl)silyloxybut-3-enyl]oxolan-2-one.
| Compound Name | (4S,5R)-5-(8-methyl-1,4-dioxaspiro[4.4]non-8-en-9-yl)-4-[(1S)-1-tri(propan-2-yl)silyloxybut-3-enyl]oxolan-2-one |
|---|---|
| PubChem CID | 71739161 |
| Molecular Formula | C25H42O5Si |
| Molecular Weight | 450.69 g/mol |
| Exact Mass | 450.28 |
| IUPAC Name | (4S,5R)-5-(8-methyl-1,4-dioxaspiro[4.4]non-8-en-9-yl)-4-[(1S)-1-tri(propan-2-yl)silyloxybut-3-enyl]oxolan-2-one |
| SMILES | C=CC[C@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@H]1CC(=O)O[C@H]1C1=C(C)CCC12OCCO2 |
| InChI | InChI=1S/C25H42O5Si/c1-9-10-21(30-31(16(2)3,17(4)5)18(6)7)20-15-22(26)29-24(20)23-19(8)11-12-25(23)27-13-14-28-25/h9,16-18,20-21,24H,1,10-15H2,2-8H3/t20-,21+,24-/m1/s1 |
| InChIKey | FFLLVXMECMMERX-ZFGGDYGUSA-N |
| XLogP | 5.91 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.69 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|