About 3,4-bis(4-chlorophenyl)-1-phenyl-2,1λ5-benzoxaphosphinine 1-oxide
3,4-bis(4-chlorophenyl)-1-phenyl-2,1λ5-benzoxaphosphinine 1-oxide (PubChem CID 71739226) has the molecular formula C26H17Cl2O2P
and a molecular weight of 463.30 g/mol. Its IUPAC name is 3,4-bis(4-chlorophenyl)-1-phenyl-2,1λ5-benzoxaphosphinine 1-oxide.
Molecular Properties
| Compound Name | 3,4-bis(4-chlorophenyl)-1-phenyl-2,1λ5-benzoxaphosphinine 1-oxide |
| PubChem CID | 71739226 |
| Molecular Formula | C26H17Cl2O2P |
| Molecular Weight | 463.30 g/mol |
| Exact Mass | 462.03 |
| IUPAC Name | 3,4-bis(4-chlorophenyl)-1-phenyl-2,1λ5-benzoxaphosphinine 1-oxide |
| SMILES | O=P1(c2ccccc2)OC(c2ccc(Cl)cc2)=C(c2ccc(Cl)cc2)c2ccccc21 |
| InChI | InChI=1S/C26H17Cl2O2P/c27-20-14-10-18(11-15-20)25-23-8-4-5-9-24(23)31(29,22-6-2-1-3-7-22)30-26(25)19-12-16-21(28)17-13-19/h1-17H |
| InChIKey | PFFSQGQLZLFJCM-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 463.30 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 3,4-bis(4-chlorophenyl)-1-phenyl-2,1λ5-benzoxaphosphinine 1-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-bis(4-chlorophenyl)-1-phenyl-2,1λ5-benzoxaphosphinine 1-oxide?
The IUPAC name of 3,4-bis(4-chlorophenyl)-1-phenyl-2,1λ5-benzoxaphosphinine 1-oxide (CID 71739226) is 3,4-bis(4-chlorophenyl)-1-phenyl-2,1λ5-benzoxaphosphinine 1-oxide.
What is the SMILES notation for 3,4-bis(4-chlorophenyl)-1-phenyl-2,1λ5-benzoxaphosphinine 1-oxide?
The canonical SMILES for 3,4-bis(4-chlorophenyl)-1-phenyl-2,1λ5-benzoxaphosphinine 1-oxide is O=P1(c2ccccc2)OC(c2ccc(Cl)cc2)=C(c2ccc(Cl)cc2)c2ccccc21.
What is the InChIKey of 3,4-bis(4-chlorophenyl)-1-phenyl-2,1λ5-benzoxaphosphinine 1-oxide?
The InChIKey is PFFSQGQLZLFJCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H17Cl2O2P/c27-20-14-10-18(11-15-20)25-23-8-4-5-9-24(23)31(29,22-6-2-1-3-7-22)30-26(25)19-12-16-21(28)17-13-19/h1-17H.
What are the key properties of 3,4-bis(4-chlorophenyl)-1-phenyl-2,1λ5-benzoxaphosphinine 1-oxide?
3,4-bis(4-chlorophenyl)-1-phenyl-2,1λ5-benzoxaphosphinine 1-oxide has a molecular weight of 463.30 g/mol, XLogP of 7.17, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-bis(4-chlorophenyl)-1-phenyl-2,1λ5-benzoxaphosphinine 1-oxide is sourced from PubChem (CID 71739226), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).