C21H38O4Si — CID 71739272
methyl (2Z,5R)-5-[[(3S)-hept-1-en-3-yl]oxy-di(propan-2-yl)silyl]oxyhepta-2,6-dienoate (PubChem CID 71739272) has the molecular formula C21H38O4Si and a molecular weight of 382.62 g/mol. Its IUPAC name is methyl (2Z,5R)-5-[[(3S)-hept-1-en-3-yl]oxy-di(propan-2-yl)silyl]oxyhepta-2,6-dienoate.
| Compound Name | methyl (2Z,5R)-5-[[(3S)-hept-1-en-3-yl]oxy-di(propan-2-yl)silyl]oxyhepta-2,6-dienoate |
|---|---|
| PubChem CID | 71739272 |
| Molecular Formula | C21H38O4Si |
| Molecular Weight | 382.62 g/mol |
| Exact Mass | 382.25 |
| IUPAC Name | methyl (2Z,5R)-5-[[(3S)-hept-1-en-3-yl]oxy-di(propan-2-yl)silyl]oxyhepta-2,6-dienoate |
| SMILES | C=C[C@H](CCCC)O[Si](O[C@@H](C=C)C/C=C\C(=O)OC)(C(C)C)C(C)C |
| InChI | InChI=1S/C21H38O4Si/c1-9-12-14-19(10-2)24-26(17(4)5,18(6)7)25-20(11-3)15-13-16-21(22)23-8/h10-11,13,16-20H,2-3,9,12,14-15H2,1,4-8H3/b16-13-/t19-,20+/m1/s1 |
| InChIKey | KTBJGKUSABPLCC-MLYXUHSOSA-N |
| XLogP | 5.70 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.62 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|