About 3-[2-[2-(5,6-dihydrobenzo[b][1]benzazepin-11-yl)ethoxy]ethylamino]butanoic acid
3-[2-[2-(5,6-dihydrobenzo[b][1]benzazepin-11-yl)ethoxy]ethylamino]butanoic acid (PubChem CID 71739594) has the molecular formula C22H28N2O3
and a molecular weight of 368.48 g/mol. Its IUPAC name is 3-[2-[2-(5,6-dihydrobenzo[b][1]benzazepin-11-yl)ethoxy]ethylamino]butanoic acid.
Molecular Properties
| Compound Name | 3-[2-[2-(5,6-dihydrobenzo[b][1]benzazepin-11-yl)ethoxy]ethylamino]butanoic acid |
| PubChem CID | 71739594 |
| Molecular Formula | C22H28N2O3 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.21 |
| IUPAC Name | 3-[2-[2-(5,6-dihydrobenzo[b][1]benzazepin-11-yl)ethoxy]ethylamino]butanoic acid |
| SMILES | CC(CC(=O)O)NCCOCCN1c2ccccc2CCc2ccccc21 |
| InChI | InChI=1S/C22H28N2O3/c1-17(16-22(25)26)23-12-14-27-15-13-24-20-8-4-2-6-18(20)10-11-19-7-3-5-9-21(19)24/h2-9,17,23H,10-16H2,1H3,(H,25,26) |
| InChIKey | ZOIPJVQREOAZBU-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[2-[2-(5,6-dihydrobenzo[b][1]benzazepin-11-yl)ethoxy]ethylamino]butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-[2-(5,6-dihydrobenzo[b][1]benzazepin-11-yl)ethoxy]ethylamino]butanoic acid?
The IUPAC name of 3-[2-[2-(5,6-dihydrobenzo[b][1]benzazepin-11-yl)ethoxy]ethylamino]butanoic acid (CID 71739594) is 3-[2-[2-(5,6-dihydrobenzo[b][1]benzazepin-11-yl)ethoxy]ethylamino]butanoic acid.
What is the SMILES notation for 3-[2-[2-(5,6-dihydrobenzo[b][1]benzazepin-11-yl)ethoxy]ethylamino]butanoic acid?
The canonical SMILES for 3-[2-[2-(5,6-dihydrobenzo[b][1]benzazepin-11-yl)ethoxy]ethylamino]butanoic acid is CC(CC(=O)O)NCCOCCN1c2ccccc2CCc2ccccc21.
What is the InChIKey of 3-[2-[2-(5,6-dihydrobenzo[b][1]benzazepin-11-yl)ethoxy]ethylamino]butanoic acid?
The InChIKey is ZOIPJVQREOAZBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H28N2O3/c1-17(16-22(25)26)23-12-14-27-15-13-24-20-8-4-2-6-18(20)10-11-19-7-3-5-9-21(19)24/h2-9,17,23H,10-16H2,1H3,(H,25,26).
What are the key properties of 3-[2-[2-(5,6-dihydrobenzo[b][1]benzazepin-11-yl)ethoxy]ethylamino]butanoic acid?
3-[2-[2-(5,6-dihydrobenzo[b][1]benzazepin-11-yl)ethoxy]ethylamino]butanoic acid has a molecular weight of 368.48 g/mol, XLogP of 3.39, 9 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-[2-(5,6-dihydrobenzo[b][1]benzazepin-11-yl)ethoxy]ethylamino]butanoic acid is sourced from PubChem (CID 71739594), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).