About (5R)-5-ethyloxolan-2-one
(5R)-5-ethyloxolan-2-one (PubChem CID 7173971) has the molecular formula C6H10O2
and a molecular weight of 114.14 g/mol. Its IUPAC name is (5R)-5-ethyloxolan-2-one.
Molecular Properties
| Compound Name | (5R)-5-ethyloxolan-2-one |
| PubChem CID | 7173971 |
| Molecular Formula | C6H10O2 |
| Molecular Weight | 114.14 g/mol |
| Exact Mass | 114.07 |
| IUPAC Name | (5R)-5-ethyloxolan-2-one |
| SMILES | CC[C@@H]1CCC(=O)O1 |
| InChI | InChI=1S/C6H10O2/c1-2-5-3-4-6(7)8-5/h5H,2-4H2,1H3/t5-/m1/s1 |
| InChIKey | JBFHTYHTHYHCDJ-RXMQYKEDSA-N |
| XLogP | 1.10 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 114.14 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (5R)-5-ethyloxolan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R)-5-ethyloxolan-2-one?
The IUPAC name of (5R)-5-ethyloxolan-2-one (CID 7173971) is (5R)-5-ethyloxolan-2-one.
What is the SMILES notation for (5R)-5-ethyloxolan-2-one?
The canonical SMILES for (5R)-5-ethyloxolan-2-one is CC[C@@H]1CCC(=O)O1.
What is the InChIKey of (5R)-5-ethyloxolan-2-one?
The InChIKey is JBFHTYHTHYHCDJ-RXMQYKEDSA-N. The full InChI is InChI=1S/C6H10O2/c1-2-5-3-4-6(7)8-5/h5H,2-4H2,1H3/t5-/m1/s1.
What are the key properties of (5R)-5-ethyloxolan-2-one?
(5R)-5-ethyloxolan-2-one has a molecular weight of 114.14 g/mol, XLogP of 1.10, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5R)-5-ethyloxolan-2-one is sourced from PubChem (CID 7173971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).