About diethyl 1-(3,4-dimethylphenyl)-3-(2-oxochromen-3-yl)pyrazole-4,5-dicarboxylate
diethyl 1-(3,4-dimethylphenyl)-3-(2-oxochromen-3-yl)pyrazole-4,5-dicarboxylate (PubChem CID 71739850) has the molecular formula C26H24N2O6
and a molecular weight of 460.49 g/mol. Its IUPAC name is diethyl 1-(3,4-dimethylphenyl)-3-(2-oxochromen-3-yl)pyrazole-4,5-dicarboxylate.
Molecular Properties
| Compound Name | diethyl 1-(3,4-dimethylphenyl)-3-(2-oxochromen-3-yl)pyrazole-4,5-dicarboxylate |
| PubChem CID | 71739850 |
| Molecular Formula | C26H24N2O6 |
| Molecular Weight | 460.49 g/mol |
| Exact Mass | 460.16 |
| IUPAC Name | diethyl 1-(3,4-dimethylphenyl)-3-(2-oxochromen-3-yl)pyrazole-4,5-dicarboxylate |
| SMILES | CCOC(=O)c1c(-c2cc3ccccc3oc2=O)nn(-c2ccc(C)c(C)c2)c1C(=O)OCC |
| InChI | InChI=1S/C26H24N2O6/c1-5-32-25(30)21-22(19-14-17-9-7-8-10-20(17)34-24(19)29)27-28(23(21)26(31)33-6-2)18-12-11-15(3)16(4)13-18/h7-14H,5-6H2,1-4H3 |
| InChIKey | TXABRBHPDFXCOV-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 100.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 460.49 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze diethyl 1-(3,4-dimethylphenyl)-3-(2-oxochromen-3-yl)pyrazole-4,5-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl 1-(3,4-dimethylphenyl)-3-(2-oxochromen-3-yl)pyrazole-4,5-dicarboxylate?
The IUPAC name of diethyl 1-(3,4-dimethylphenyl)-3-(2-oxochromen-3-yl)pyrazole-4,5-dicarboxylate (CID 71739850) is diethyl 1-(3,4-dimethylphenyl)-3-(2-oxochromen-3-yl)pyrazole-4,5-dicarboxylate.
What is the SMILES notation for diethyl 1-(3,4-dimethylphenyl)-3-(2-oxochromen-3-yl)pyrazole-4,5-dicarboxylate?
The canonical SMILES for diethyl 1-(3,4-dimethylphenyl)-3-(2-oxochromen-3-yl)pyrazole-4,5-dicarboxylate is CCOC(=O)c1c(-c2cc3ccccc3oc2=O)nn(-c2ccc(C)c(C)c2)c1C(=O)OCC.
What is the InChIKey of diethyl 1-(3,4-dimethylphenyl)-3-(2-oxochromen-3-yl)pyrazole-4,5-dicarboxylate?
The InChIKey is TXABRBHPDFXCOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H24N2O6/c1-5-32-25(30)21-22(19-14-17-9-7-8-10-20(17)34-24(19)29)27-28(23(21)26(31)33-6-2)18-12-11-15(3)16(4)13-18/h7-14H,5-6H2,1-4H3.
What are the key properties of diethyl 1-(3,4-dimethylphenyl)-3-(2-oxochromen-3-yl)pyrazole-4,5-dicarboxylate?
diethyl 1-(3,4-dimethylphenyl)-3-(2-oxochromen-3-yl)pyrazole-4,5-dicarboxylate has a molecular weight of 460.49 g/mol, XLogP of 4.62, 6 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl 1-(3,4-dimethylphenyl)-3-(2-oxochromen-3-yl)pyrazole-4,5-dicarboxylate is sourced from PubChem (CID 71739850), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).