C26H25N5O — CID 71739938
4-[4-[2-(quinolin-6-ylmethyl)indazol-6-yl]pyrazol-1-yl]cyclohexan-1-ol (PubChem CID 71739938) has the molecular formula C26H25N5O and a molecular weight of 423.52 g/mol. Its IUPAC name is 4-[4-[2-(quinolin-6-ylmethyl)indazol-6-yl]pyrazol-1-yl]cyclohexan-1-ol.
| Compound Name | 4-[4-[2-(quinolin-6-ylmethyl)indazol-6-yl]pyrazol-1-yl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 71739938 |
| Molecular Formula | C26H25N5O |
| Molecular Weight | 423.52 g/mol |
| Exact Mass | 423.21 |
| IUPAC Name | 4-[4-[2-(quinolin-6-ylmethyl)indazol-6-yl]pyrazol-1-yl]cyclohexan-1-ol |
| SMILES | OC1CCC(n2cc(-c3ccc4cn(Cc5ccc6ncccc6c5)nc4c3)cn2)CC1 |
| InChI | InChI=1S/C26H25N5O/c32-24-8-6-23(7-9-24)31-17-22(14-28-31)19-4-5-21-16-30(29-26(21)13-19)15-18-3-10-25-20(12-18)2-1-11-27-25/h1-5,10-14,16-17,23-24,32H,6-9,15H2 |
| InChIKey | IOEGMAJBPLCGLZ-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.52 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |