C16H18O3 — CID 71740268
3-[1-(3-methyl-1-benzofuran-2-yl)ethyl]pentane-2,4-dione (PubChem CID 71740268) has the molecular formula C16H18O3 and a molecular weight of 258.32 g/mol. Its IUPAC name is 3-[1-(3-methyl-1-benzofuran-2-yl)ethyl]pentane-2,4-dione.
| Compound Name | 3-[1-(3-methyl-1-benzofuran-2-yl)ethyl]pentane-2,4-dione |
|---|---|
| PubChem CID | 71740268 |
| Molecular Formula | C16H18O3 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.13 |
| IUPAC Name | 3-[1-(3-methyl-1-benzofuran-2-yl)ethyl]pentane-2,4-dione |
| SMILES | CC(=O)C(C(C)=O)C(C)c1oc2ccccc2c1C |
| InChI | InChI=1S/C16H18O3/c1-9-13-7-5-6-8-14(13)19-16(9)10(2)15(11(3)17)12(4)18/h5-8,10,15H,1-4H3 |
| InChIKey | UXDGOGLOSNFPGD-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 47.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|