C29H28N2O7 — CID 71740358
diethyl 3-(2,2-dimethyl-8-oxo-3,4-dihydropyrano[3,2-g]chromen-7-yl)-1-phenylpyrazole-4,5-dicarboxylate (PubChem CID 71740358) has the molecular formula C29H28N2O7 and a molecular weight of 516.55 g/mol. Its IUPAC name is diethyl 3-(2,2-dimethyl-8-oxo-3,4-dihydropyrano[3,2-g]chromen-7-yl)-1-phenylpyrazole-4,5-dicarboxylate.
| Compound Name | diethyl 3-(2,2-dimethyl-8-oxo-3,4-dihydropyrano[3,2-g]chromen-7-yl)-1-phenylpyrazole-4,5-dicarboxylate |
|---|---|
| PubChem CID | 71740358 |
| Molecular Formula | C29H28N2O7 |
| Molecular Weight | 516.55 g/mol |
| Exact Mass | 516.19 |
| IUPAC Name | diethyl 3-(2,2-dimethyl-8-oxo-3,4-dihydropyrano[3,2-g]chromen-7-yl)-1-phenylpyrazole-4,5-dicarboxylate |
| SMILES | CCOC(=O)c1c(-c2cc3cc4c(cc3oc2=O)OC(C)(C)CC4)nn(-c2ccccc2)c1C(=O)OCC |
| InChI | InChI=1S/C29H28N2O7/c1-5-35-27(33)23-24(30-31(19-10-8-7-9-11-19)25(23)28(34)36-6-2)20-15-18-14-17-12-13-29(3,4)38-22(17)16-21(18)37-26(20)32/h7-11,14-16H,5-6,12-13H2,1-4H3 |
| InChIKey | OZCQIQFOTKISEZ-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 109.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.55 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|