About 5-[(1-piperidin-4-yltriazol-4-yl)methyl]-6,7-dihydro-4H-thieno[3,2-c]pyridine
5-[(1-piperidin-4-yltriazol-4-yl)methyl]-6,7-dihydro-4H-thieno[3,2-c]pyridine (PubChem CID 71740371) has the molecular formula C15H21N5S
and a molecular weight of 303.43 g/mol. Its IUPAC name is 5-[(1-piperidin-4-yltriazol-4-yl)methyl]-6,7-dihydro-4H-thieno[3,2-c]pyridine.
Molecular Properties
| Compound Name | 5-[(1-piperidin-4-yltriazol-4-yl)methyl]-6,7-dihydro-4H-thieno[3,2-c]pyridine |
| PubChem CID | 71740371 |
| Molecular Formula | C15H21N5S |
| Molecular Weight | 303.43 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | 5-[(1-piperidin-4-yltriazol-4-yl)methyl]-6,7-dihydro-4H-thieno[3,2-c]pyridine |
| SMILES | c1cc2c(s1)CCN(Cc1cn(C3CCNCC3)nn1)C2 |
| InChI | InChI=1S/C15H21N5S/c1-5-16-6-2-14(1)20-11-13(17-18-20)10-19-7-3-15-12(9-19)4-8-21-15/h4,8,11,14,16H,1-3,5-7,9-10H2 |
| InChIKey | VAFAQMQSPUPWAU-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.43 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-[(1-piperidin-4-yltriazol-4-yl)methyl]-6,7-dihydro-4H-thieno[3,2-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(1-piperidin-4-yltriazol-4-yl)methyl]-6,7-dihydro-4H-thieno[3,2-c]pyridine?
The IUPAC name of 5-[(1-piperidin-4-yltriazol-4-yl)methyl]-6,7-dihydro-4H-thieno[3,2-c]pyridine (CID 71740371) is 5-[(1-piperidin-4-yltriazol-4-yl)methyl]-6,7-dihydro-4H-thieno[3,2-c]pyridine.
What is the SMILES notation for 5-[(1-piperidin-4-yltriazol-4-yl)methyl]-6,7-dihydro-4H-thieno[3,2-c]pyridine?
The canonical SMILES for 5-[(1-piperidin-4-yltriazol-4-yl)methyl]-6,7-dihydro-4H-thieno[3,2-c]pyridine is c1cc2c(s1)CCN(Cc1cn(C3CCNCC3)nn1)C2.
What is the InChIKey of 5-[(1-piperidin-4-yltriazol-4-yl)methyl]-6,7-dihydro-4H-thieno[3,2-c]pyridine?
The InChIKey is VAFAQMQSPUPWAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21N5S/c1-5-16-6-2-14(1)20-11-13(17-18-20)10-19-7-3-15-12(9-19)4-8-21-15/h4,8,11,14,16H,1-3,5-7,9-10H2.
What are the key properties of 5-[(1-piperidin-4-yltriazol-4-yl)methyl]-6,7-dihydro-4H-thieno[3,2-c]pyridine?
5-[(1-piperidin-4-yltriazol-4-yl)methyl]-6,7-dihydro-4H-thieno[3,2-c]pyridine has a molecular weight of 303.43 g/mol, XLogP of 1.82, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(1-piperidin-4-yltriazol-4-yl)methyl]-6,7-dihydro-4H-thieno[3,2-c]pyridine is sourced from PubChem (CID 71740371), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).