C30H30N8O4 — CID 71740603
2-[3-[4-[4-[1-[3-(1,3-dioxoisoindol-2-yl)propyl]triazol-4-yl]butyl]triazol-1-yl]propyl]isoindole-1,3-dione (PubChem CID 71740603) has the molecular formula C30H30N8O4 and a molecular weight of 566.62 g/mol. Its IUPAC name is 2-[3-[4-[4-[1-[3-(1,3-dioxoisoindol-2-yl)propyl]triazol-4-yl]butyl]triazol-1-yl]propyl]isoindole-1,3-dione.
| Compound Name | 2-[3-[4-[4-[1-[3-(1,3-dioxoisoindol-2-yl)propyl]triazol-4-yl]butyl]triazol-1-yl]propyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 71740603 |
| Molecular Formula | C30H30N8O4 |
| Molecular Weight | 566.62 g/mol |
| Exact Mass | 566.24 |
| IUPAC Name | 2-[3-[4-[4-[1-[3-(1,3-dioxoisoindol-2-yl)propyl]triazol-4-yl]butyl]triazol-1-yl]propyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CCCn1cc(CCCCc2cn(CCCN3C(=O)c4ccccc4C3=O)nn2)nn1 |
| InChI | InChI=1S/C30H30N8O4/c39-27-23-11-3-4-12-24(23)28(40)37(27)17-7-15-35-19-21(31-33-35)9-1-2-10-22-20-36(34-32-22)16-8-18-38-29(41)25-13-5-6-14-26(25)30(38)42/h3-6,11-14,19-20H,1-2,7-10,15-18H2 |
| InChIKey | MLFKCZSWQWPESW-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 136.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.62 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|