C30H38N4 — CID 71740897
8-methyl-2-[6-(8-methyl-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)hexyl]-1,3,4,5-tetrahydropyrido[4,3-b]indole (PubChem CID 71740897) has the molecular formula C30H38N4 and a molecular weight of 454.66 g/mol. Its IUPAC name is 8-methyl-2-[6-(8-methyl-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)hexyl]-1,3,4,5-tetrahydropyrido[4,3-b]indole.
| Compound Name | 8-methyl-2-[6-(8-methyl-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)hexyl]-1,3,4,5-tetrahydropyrido[4,3-b]indole |
|---|---|
| PubChem CID | 71740897 |
| Molecular Formula | C30H38N4 |
| Molecular Weight | 454.66 g/mol |
| Exact Mass | 454.31 |
| IUPAC Name | 8-methyl-2-[6-(8-methyl-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)hexyl]-1,3,4,5-tetrahydropyrido[4,3-b]indole |
| SMILES | Cc1ccc2[nH]c3c(c2c1)CN(CCCCCCN1CCc2[nH]c4ccc(C)cc4c2C1)CC3 |
| InChI | InChI=1S/C30H38N4/c1-21-7-9-27-23(17-21)25-19-33(15-11-29(25)31-27)13-5-3-4-6-14-34-16-12-30-26(20-34)24-18-22(2)8-10-28(24)32-30/h7-10,17-18,31-32H,3-6,11-16,19-20H2,1-2H3 |
| InChIKey | QKWIPFQYVMSHKA-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.66 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|