C31H44N2O2 — CID 71740919
ethyl (1S,4S,5R,9S,10S,13S,18R)-16-(2,6-dimethylphenyl)-5,9,13-trimethyl-15,16-diazapentacyclo[11.5.1.01,10.04,9.014,18]nonadec-14-ene-5-carboxylate (PubChem CID 71740919) has the molecular formula C31H44N2O2 and a molecular weight of 476.71 g/mol. Its IUPAC name is ethyl (1S,4S,5R,9S,10S,13S,18R)-16-(2,6-dimethylphenyl)-5,9,13-trimethyl-15,16-diazapentacyclo[11.5.1.01,10.04,9.014,18]nonadec-14-ene-5-carboxylate.
| Compound Name | ethyl (1S,4S,5R,9S,10S,13S,18R)-16-(2,6-dimethylphenyl)-5,9,13-trimethyl-15,16-diazapentacyclo[11.5.1.01,10.04,9.014,18]nonadec-14-ene-5-carboxylate |
|---|---|
| PubChem CID | 71740919 |
| Molecular Formula | C31H44N2O2 |
| Molecular Weight | 476.71 g/mol |
| Exact Mass | 476.34 |
| IUPAC Name | ethyl (1S,4S,5R,9S,10S,13S,18R)-16-(2,6-dimethylphenyl)-5,9,13-trimethyl-15,16-diazapentacyclo[11.5.1.01,10.04,9.014,18]nonadec-14-ene-5-carboxylate |
| SMILES | CCOC(=O)[C@]1(C)CCC[C@@]2(C)[C@@H]3CC[C@@]4(C)C[C@]3(CC[C@@H]21)[C@@H]1CN(c2c(C)cccc2C)N=C14 |
| InChI | InChI=1S/C31H44N2O2/c1-7-35-27(34)30(6)15-9-14-29(5)23(30)13-17-31-19-28(4,16-12-24(29)31)26-22(31)18-33(32-26)25-20(2)10-8-11-21(25)3/h8,10-11,22-24H,7,9,12-19H2,1-6H3/t22-,23+,24+,28+,29-,30-,31-/m1/s1 |
| InChIKey | JHEAAHVNFMNSKZ-UVYKMFLPSA-N |
| XLogP | 7.07 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.71 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |