About CID 71740930
CID 71740930 (PubChem CID 71740930) has the molecular formula C43H34N2O2S
and a molecular weight of 642.82 g/mol.
Molecular Properties
| Compound Name | CID 71740930 |
| PubChem CID | 71740930 |
| Molecular Formula | C43H34N2O2S |
| Molecular Weight | 642.82 g/mol |
| Exact Mass | 642.23 |
| IUPAC Name | — |
| SMILES | CN1C/C(=C\c2cccc3ccccc23)C(=O)C2(C1)[C@@H](c1cccc3ccccc13)[C@@H]1CSCN1[C@@]21C(=O)c2cccc3cccc1c23 |
| InChI | InChI=1S/C43H34N2O2S/c1-44-23-31(22-30-16-6-12-27-10-2-4-17-32(27)30)40(46)42(25-44)39(34-19-7-13-28-11-3-5-18-33(28)34)37-24-48-26-45(37)43(42)36-21-9-15-29-14-8-20-35(38(29)36)41(43)47/h2-22,37,39H,23-26H2,1H3/b31-22+/t37-,39-,42?,43-/m0/s1 |
| InChIKey | NYHXERAQTBJURR-SDDNBIPNSA-N |
| XLogP | 8.29 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 48 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 642.82 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze CID 71740930 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 71740930?
The IUPAC name of CID 71740930 (CID 71740930) is not available.
What is the SMILES notation for CID 71740930?
The canonical SMILES for CID 71740930 is CN1C/C(=C\c2cccc3ccccc23)C(=O)C2(C1)[C@@H](c1cccc3ccccc13)[C@@H]1CSCN1[C@@]21C(=O)c2cccc3cccc1c23.
What is the InChIKey of CID 71740930?
The InChIKey is NYHXERAQTBJURR-SDDNBIPNSA-N. The full InChI is InChI=1S/C43H34N2O2S/c1-44-23-31(22-30-16-6-12-27-10-2-4-17-32(27)30)40(46)42(25-44)39(34-19-7-13-28-11-3-5-18-33(28)34)37-24-48-26-45(37)43(42)36-21-9-15-29-14-8-20-35(38(29)36)41(43)47/h2-22,37,39H,23-26H2,1H3/b31-22+/t37-,39-,42?,43-/m0/s1.
What are the key properties of CID 71740930?
CID 71740930 has a molecular weight of 642.82 g/mol, XLogP of 8.29, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 71740930 is sourced from PubChem (CID 71740930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).