C20H24O5 — CID 71740941
(1R,2Z,5E,10S,14R,15S)-10-hydroxy-3,7,7,10,14-pentamethyl-16-oxatricyclo[10.4.0.01,15]hexadeca-2,5,12-triene-4,9,11-trione (PubChem CID 71740941) has the molecular formula C20H24O5 and a molecular weight of 344.41 g/mol. Its IUPAC name is (1R,2Z,5E,10S,14R,15S)-10-hydroxy-3,7,7,10,14-pentamethyl-16-oxatricyclo[10.4.0.01,15]hexadeca-2,5,12-triene-4,9,11-trione.
| Compound Name | (1R,2Z,5E,10S,14R,15S)-10-hydroxy-3,7,7,10,14-pentamethyl-16-oxatricyclo[10.4.0.01,15]hexadeca-2,5,12-triene-4,9,11-trione |
|---|---|
| PubChem CID | 71740941 |
| Molecular Formula | C20H24O5 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | (1R,2Z,5E,10S,14R,15S)-10-hydroxy-3,7,7,10,14-pentamethyl-16-oxatricyclo[10.4.0.01,15]hexadeca-2,5,12-triene-4,9,11-trione |
| SMILES | C/C1=C/[C@]23O[C@H]2[C@H](C)C=C3C(=O)[C@@](C)(O)C(=O)CC(C)(C)/C=C/C1=O |
| InChI | InChI=1S/C20H24O5/c1-11-8-13-16(23)19(5,24)15(22)10-18(3,4)7-6-14(21)12(2)9-20(13)17(11)25-20/h6-9,11,17,24H,10H2,1-5H3/b7-6+,12-9-/t11-,17+,19+,20-/m1/s1 |
| InChIKey | FIRDPUAWQIZLCV-YGZJLGPDSA-N |
| XLogP | 2.09 |
| TPSA | 83.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|