C21H28O3 — CID 71740946
(1R,3R,6Z,10S)-3,7,10,11,11,14-hexamethyl-16-oxatricyclo[11.2.1.01,5]hexadeca-4,6,13-triene-8,15-dione (PubChem CID 71740946) has the molecular formula C21H28O3 and a molecular weight of 328.45 g/mol. Its IUPAC name is (1R,3R,6Z,10S)-3,7,10,11,11,14-hexamethyl-16-oxatricyclo[11.2.1.01,5]hexadeca-4,6,13-triene-8,15-dione.
| Compound Name | (1R,3R,6Z,10S)-3,7,10,11,11,14-hexamethyl-16-oxatricyclo[11.2.1.01,5]hexadeca-4,6,13-triene-8,15-dione |
|---|---|
| PubChem CID | 71740946 |
| Molecular Formula | C21H28O3 |
| Molecular Weight | 328.45 g/mol |
| Exact Mass | 328.20 |
| IUPAC Name | (1R,3R,6Z,10S)-3,7,10,11,11,14-hexamethyl-16-oxatricyclo[11.2.1.01,5]hexadeca-4,6,13-triene-8,15-dione |
| SMILES | CC1=C2CC(C)(C)[C@@H](C)CC(=O)/C(C)=C\C3=C[C@H](C)C[C@]3(O2)C1=O |
| InChI | InChI=1S/C21H28O3/c1-12-7-16-8-13(2)17(22)9-14(3)20(5,6)11-18-15(4)19(23)21(16,10-12)24-18/h7-8,12,14H,9-11H2,1-6H3/b13-8-/t12-,14-,21+/m0/s1 |
| InChIKey | YSJDOKRVCCIBIM-IZVNHAAGSA-N |
| XLogP | 4.54 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.45 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |