C31H42N2O2 — CID 71741039
ethyl (1S,4S,5R,9S,10S,13S)-15-(3,4-dimethylphenyl)-5,9,13-trimethyl-15,16-diazapentacyclo[11.5.1.01,10.04,9.014,18]nonadeca-14(18),16-diene-5-carboxylate (PubChem CID 71741039) has the molecular formula C31H42N2O2 and a molecular weight of 474.69 g/mol. Its IUPAC name is ethyl (1S,4S,5R,9S,10S,13S)-15-(3,4-dimethylphenyl)-5,9,13-trimethyl-15,16-diazapentacyclo[11.5.1.01,10.04,9.014,18]nonadeca-14(18),16-diene-5-carboxylate.
| Compound Name | ethyl (1S,4S,5R,9S,10S,13S)-15-(3,4-dimethylphenyl)-5,9,13-trimethyl-15,16-diazapentacyclo[11.5.1.01,10.04,9.014,18]nonadeca-14(18),16-diene-5-carboxylate |
|---|---|
| PubChem CID | 71741039 |
| Molecular Formula | C31H42N2O2 |
| Molecular Weight | 474.69 g/mol |
| Exact Mass | 474.32 |
| IUPAC Name | ethyl (1S,4S,5R,9S,10S,13S)-15-(3,4-dimethylphenyl)-5,9,13-trimethyl-15,16-diazapentacyclo[11.5.1.01,10.04,9.014,18]nonadeca-14(18),16-diene-5-carboxylate |
| SMILES | CCOC(=O)[C@]1(C)CCC[C@@]2(C)[C@@H]3CC[C@@]4(C)C[C@]3(CC[C@@H]21)c1cnn(-c2ccc(C)c(C)c2)c14 |
| InChI | InChI=1S/C31H42N2O2/c1-7-35-27(34)30(6)14-8-13-29(5)24(30)12-16-31-19-28(4,15-11-25(29)31)26-23(31)18-32-33(26)22-10-9-20(2)21(3)17-22/h9-10,17-18,24-25H,7-8,11-16,19H2,1-6H3/t24-,25-,28-,29+,30+,31+/m0/s1 |
| InChIKey | PNHLJPSTRYLXKI-WWNLHDJJSA-N |
| XLogP | 6.97 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.69 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |