C21H26O3 — CID 71741065
(1R,3R,6Z,11S)-3,7,12,12,15-pentamethyl-9,17-dioxatetracyclo[12.2.1.18,11.01,5]octadeca-4,6,8(18),14-tetraen-16-one (PubChem CID 71741065) has the molecular formula C21H26O3 and a molecular weight of 326.44 g/mol. Its IUPAC name is (1R,3R,6Z,11S)-3,7,12,12,15-pentamethyl-9,17-dioxatetracyclo[12.2.1.18,11.01,5]octadeca-4,6,8(18),14-tetraen-16-one.
| Compound Name | (1R,3R,6Z,11S)-3,7,12,12,15-pentamethyl-9,17-dioxatetracyclo[12.2.1.18,11.01,5]octadeca-4,6,8(18),14-tetraen-16-one |
|---|---|
| PubChem CID | 71741065 |
| Molecular Formula | C21H26O3 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.19 |
| IUPAC Name | (1R,3R,6Z,11S)-3,7,12,12,15-pentamethyl-9,17-dioxatetracyclo[12.2.1.18,11.01,5]octadeca-4,6,8(18),14-tetraen-16-one |
| SMILES | CC1=C2CC(C)(C)[C@@H]3C=C(OC3)/C(C)=C\C3=C[C@H](C)C[C@]3(O2)C1=O |
| InChI | InChI=1S/C21H26O3/c1-12-6-15-7-13(2)17-8-16(11-23-17)20(4,5)10-18-14(3)19(22)21(15,9-12)24-18/h6-8,12,16H,9-11H2,1-5H3/b13-7-/t12-,16+,21+/m0/s1 |
| InChIKey | KYGLWMKSYYUXQX-GPGLQCBXSA-N |
| XLogP | 4.47 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |